Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-디나이트로벤조일 염화물
3,5-디나이트로벤조일염화물 · 3,5-디니트로벤조일클로라이드 · DNBC · 3,5-dinitrobenzoyl · NSC 2697 · Dinitrobenzoyl chlorid · 5-Dinitrobenzoyl chloride · 3,5-dinitrobenoyl chloride
식별자 및 물리적 특성
| CAS No. | 99-33-2 |
|---|---|
| 분자식 | C7H3ClN2O5 |
| 평균 분자량 | 230.56 g/mol |
| 단동위원소 질량 | 229.97304888 g/mol |
| SMILES | O=C(Cl)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChIKey | NNOHXABAQAGKRZ-UHFFFAOYSA-N |
| PubChem CID | 7432 |
| ChEMBL | CHEMBL2005426 |
| EC No. | 202-750-6 |
| DTXSID | DTXSID2059194 |
| 현지명 | 3,5-디나이트로벤조일 염화물 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 109 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 275 |
| 물질 분류 | Nitrogen Compounds -> Other Aromatics (Nitrogen) |
| SpringerMaterials Properties | Density |
| Physical Description | Solid[Merck Index] Light yellow crystals[Sigma-Aldrich MSDS] |
| 녹는점 | 68-69 °C(lit.) |
| 끓는 점 | 196 °C11 mm Hg(lit.) |
| 밀도 | 1.8836 (rough estimate) |
| 증기 밀도 | 7.6 (vs air) |
| 굴절률 | 1.6290 (estimate) |
| 인화점 | 196°C/12mm |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름(약간 용해됨), 에틸아세테이트(약간 용해됨) |
| 물리적 상태 | 결정이나 바늘 모양의 결정입니다 |
| 색상 | 노란색에서 베이지색 |
| 용해도 | 물에 약간 용해됩니다. |
| Merck | 14,3277 |
| BRN | 990249 |
| 안정성 | 안정적인. 강한 산화제, 물, 습기, 질산염, 가연성 물질과 호환되지 않습니다. 냉장보관하세요. |
| InChI | 1S/C7H3ClN2O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H |
| InChIKey | NNOHXABAQAGKRZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(cc(c1)[N+]([O-])=O)C(Cl)=O |
| NIST | Benzoyl chloride, 3,5-dinitro-(99-33-2) |
| EPA | Benzoyl chloride, 3,5-dinitro- (99-33-2) |
화학적 성질
yellow-brown solid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 7 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: Benzoyl chloride, 3,5-dinitro-Status: Active Update: 04-10-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/206843,5-Dinitrobenzoyl chloride: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Highly irritating[Merck Index] Causes burns and lachrymationInhalation may cause corrosive injuries to upper respiratory tract and lungsTargets the liver and kidney[Sigma-Aldrich MSDS] Reacts violently with waterMay explode on heating[Alfa Aesar MSDS] See Benzoyl chloride and m-Dinitrobenzene. |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DM6637000 |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29400090 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45-25 |
| 포장분류 | II |
| 위험 등급 | 8Skin Corr. 1B |
| 기존화학 물질 | KE-11938 |
| F 고인화성물질 | 21 |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
3,5-dinitrobenzoyl chloride is an important intermediate for organic synthesis.