Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(Phenylmethoxy)benzenemethanol
RARECHEM AL BD 0066 · Ammonium Sulphate LR · M-phenoxy phenylcarbinol · 3-BENZYLOXYBENZYL ALCOHOL · (3-BENZYLOXYPHENYL)METHANOL · 3-Benzyloxybenzylic Alcohol · 3-Benzyloxybenzyl alcohol,97% · 3-Benzyloxybenzyl Alcohol >(3-phenylmethoxyphenyl)methanol
식별자 및 물리적 특성
| CAS No. | 1700-30-7 |
|---|---|
| 분자식 | C14H14O2 |
| 평균 분자량 | 214.26 g/mol |
| 단동위원소 질량 | 214.09937969 g/mol |
| SMILES | OCc1cccc(OCc2ccccc2)c1 |
| InChIKey | AFKLSWIRJUJWKY-UHFFFAOYSA-N |
| PubChem CID | 74341 |
| EC No. | 216-931-2 |
| DTXSID | DTXSID70168782 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 29.5 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 187 |
| 녹는점 | 48 °C(lit.) |
| 끓는 점 | 160°C/3mmHg(lit.) |
| 밀도 | 1.0781 (rough estimate) |
| 굴절률 | 1.5300 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Store at room temperature |
| 용해도 | 클로로포름, 디클로로메탄, 에틸아세테이트, 메탄올에 용해됨 |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 14.30±0.10(Predicted) |
| 색상 | 밝은 노란색에서 밝은 베이지색까지 |
| InChI | InChI=1S/C14H14O2/c15-10-13-7-4-8-14(9-13)16-11-12-5-2-1-3-6-12/h1-9,15H,10-11H2 |
| InChIKey | AFKLSWIRJUJWKY-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC(OCC2=CC=CC=C2)=C1 |
화학적 성질
white to light yellow crystal powde
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzenemethanol, 3-(phenylmethoxy)-: Does not have an individual approval but may be used under an appropriate group standard |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29062990 |
| 위험 문구(R) | 36/38-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37/39-26-36-24/25 |
| 기존화학 물질 | KE-02815 |
용도
용도
3-Benzyloxybenzyl alcohol serves as a precursor for the synthesis of 3-benzyloxybenzyl bromide using tetrabromomethane and triphenylphosphine[1].