Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ethyl 2-methylnicotinate
2-methylnicotin ethyl ester · Ethyl 2-methylnicotite · ETHYL 2-METHYLNICOTINATE · ethyle2-methylnicotinate · Ethyl 2-methylinicotinate · Ethyl2-Methylnicotinate>Ethyl2-methylnicotinate,97% · Ethyl 2-methylnicotinate 98% · 2-METHYLNICOTINIC ACID ETHYL ESTER
식별자 및 물리적 특성
| CAS No. | 1721-26-2 |
|---|---|
| 분자식 | C9H11NO2 |
| 평균 분자량 | 165.19 g/mol |
| 단동위원소 질량 | 165.07897859 g/mol |
| SMILES | CCOC(=O)c1cccnc1C |
| InChIKey | TZORNSWZUZDUCU-UHFFFAOYSA-N |
| PubChem CID | 74401 |
| ChEMBL | CHEMBL217217 |
| EC No. | 217-013-4 |
| DTXSID | DTXSID80169205 |
화학 및 물리적 성질
| XLogP | 1.5 |
|---|---|
| 극성 표면적 | 39.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 159 |
| 녹는점 | 146-147 °C |
| 끓는 점 | 126-127 °C24 mm Hg(lit.) |
| 밀도 | 1.072 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.505(lit.) |
| 인화점 | 217 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| pKa(산도 계수) | 4.02±0.10(Predicted) |
| 물리적 상태 | 액체 |
| 색상 | 무색~주황색 투명 |
| 용해도 | 물에 약간 용해됩니다. |
| BRN | 118200 |
| InChI | InChI=1S/C9H11NO2/c1-3-12-9(11)8-5-4-6-10-7(8)2/h4-6H,3H2,1-2H3 |
| InChIKey | TZORNSWZUZDUCU-UHFFFAOYSA-N |
| SMILES | C1(C)=NC=CC=C1C(OCC)=O |
| NIST | Ethyl 2-methylnicotinate(1721-26-2) |
화학적 성질
Colorless liquid
안전 및 규제
| GHS 분류 | WarningH315 (90.7%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (90.7%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29333990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
Ethyl 2-methylpyridine-3-carboxylate was used in the preparation of amino esters such as ethyl 2(piperidinylaminomethyl)benzoate, ethyl 2-(N-benzyl-N-methylaminomethyl)benzoate, ethyl 2-(diethylaminomethyl)benzoate.