Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Chloro-6-methoxypyridazine
NSC 69819 · NSC 522667 · TIMTEC-BB SBB004124 · SPECS AC-907/25014054 · 3-Chloro-6-methoxypyrazine · 6-Chloro-3-methoxypyridazine · 3-Methoxy-6-chloropyridazine · 3-Chloro-6-methoxypyridazine
식별자 및 물리적 특성
| CAS No. | 1722-10-7 |
|---|---|
| 분자식 | C5H5ClN2O |
| 평균 분자량 | 144.56 g/mol |
| 단동위원소 질량 | 144.00904046 g/mol |
| SMILES | COc1ccc(Cl)nn1 |
| InChIKey | XBJLKXOOHLLTPG-UHFFFAOYSA-N |
| PubChem CID | 74403 |
| EC No. | 217-019-7 |
| DTXSID | DTXSID10169213 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 35 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 91 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| LogP(분배 계수) | 0.89 |
| 녹는점 | 84-85 °C(lit.) |
| 끓는 점 | 285℃ |
| 밀도 | 1.292 |
| 인화점 | 126℃ |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | powder to crystal |
| pKa(산도 계수) | 0.74±0.10(Predicted) |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 118854 |
| InChI | InChI=1S/C5H5ClN2O/c1-9-5-3-2-4(6)7-8-5/h2-3H,1H3 |
| InChIKey | XBJLKXOOHLLTPG-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=C(OC)C=C1 |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 2933998090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Chloro-6-methoxypyridazine was used in the preparation of number of α-aryl-α-(pyridazin-3-yl)-acetonitriles.
일반 설명
3-Chloro-6-methoxypyridazine undergoes regioselective metallation using various lithium alkylamides, temperatures and solvents (THF and ether). It was lithiated using lithium 2,2,6,6-tetramethylpiperidide during the synthesis of minaprine.