Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-클로로-4-니트로벤조산
2-클로로-4-니트로벤조산 · 2-chloro-4-nitro-benzoicaci · 4-NITRO-2-CHLOROBENZOIC ACID · NSC 150 · 2,4-CNBA · Clc6h3(no2)cooh · RARECHEM AL BO 0521 · TIMTEC-BB SBB000403
식별자 및 물리적 특성
| CAS No. | 99-60-5 |
|---|---|
| 분자식 | C7H4ClNO4 |
| 평균 분자량 | 201.56 g/mol |
| 단동위원소 질량 | 200.98288529 g/mol |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1Cl |
| InChIKey | QAYNSPOKTRVZRC-UHFFFAOYSA-N |
| PubChem CID | 7448 |
| ChEMBL | CHEMBL4160413 |
| EC No. | 202-771-0 |
| DTXSID | DTXSID2059198 |
| 현지명 | 2-클로로-4-니트로벤조산 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 83.1 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| LogP(분배 계수) | 2.19 |
| 녹는점 | 136-140 °C(lit.) |
| 끓는 점 | 160.5°C (rough estimate) |
| 밀도 | 1.5719 (rough estimate) |
| 굴절률 | 1.6000 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | pK1: 1.96 (25°C) |
| 색상 | 밝은 노란색에서 밝은 녹색까지 |
| 용해도 | 1g/L(20℃) |
| BRN | 1912836 |
| InChI | InChI=1S/C7H4ClNO4/c8-6-3-4(9(12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | QAYNSPOKTRVZRC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C=C1Cl |
| EPA | Benzoic acid, 2-chloro-4-nitro- (99-60-5) |
화학적 성질
light yellow to light green crystalline powder
안전 및 규제
| GHS 분류 | DangerH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P354+P338, P317, P319, P321, P332+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 54 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | 2-Chloro-4-nitrobenzoic acid: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | DG5425000 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38-41-37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
용도
용도
The active pharmaceutical ingredient 2-chloro-4-nitrobenzoic acid (2c4n) is a potentially novel therapy for immunodeficiency diseases as an anti-viral and anti-cancer agent and is a dimorph in the solid state. 2c4n is a historically significant compound from a polymorphic point of view, as it was one of the samples used by Ebert and Gottlieb to show that polymorphs can be identified or differentiated through their IR spectra back in 1952[1].