Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,2-Diphenylacetyl chloride
2,2-Diphenylacetyl chloride · Dpac · EOS-61468 · Diphenylacetyl · TIMTEC-BB SBB006586 · diphenyl-acetylchlorid · DIPHENYLACETYL CHLORIDE · DiphenylacetylChloride>diphenylaceticacidchloride
식별자 및 물리적 특성
| CAS No. | 1871-76-7 |
|---|---|
| 분자식 | C14H11ClO |
| 평균 분자량 | 230.69 g/mol |
| 단동위원소 질량 | 230.04984265 g/mol |
| SMILES | O=C(Cl)C(c1ccccc1)c1ccccc1 |
| InChIKey | MSYLETHDEIJMAF-UHFFFAOYSA-N |
| PubChem CID | 74637 |
| EC No. | 217-493-5 |
| DTXSID | DTXSID30171979 |
화학 및 물리적 성질
| XLogP | 4.1 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 209 |
| 녹는점 | 49-53 °C (lit.) |
| 끓는 점 | 175-176 °C/17 mmHg (lit.) |
| 밀도 | 1.1223 (rough estimate) |
| 굴절률 | 1.5260 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Store below +30°C. |
| 용해도 | 클로로포름 (약간 용해됨), DMSO (약간 용해됨) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 약간 노란색 |
| Merck | 14,3316 |
| BRN | 1211588 |
| InChI | InChI=1S/C14H11ClO/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H |
| InChIKey | MSYLETHDEIJMAF-UHFFFAOYSA-N |
| SMILES | C(C(Cl)=O)(C1C=CC=CC=1)C1=CC=CC=C1 |
| NIST | Diphenylacetyl chloride(1871-76-7) |
화학적 성질
SLIGHTLY YELLOWISH CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P271, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P319, P321, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 10-01-2018 https://echa.europa.eu/registration-dossier/-/registered-dossier/21746 |
| Hazard Classes and Categories | Skin Corr. 1C (100%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | AO6750000 |
| 운송 번호(UN) | UN 3261 8/PG 2 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 34-36/37 |
| 위험 표시 | C |
| 안전 문구(S) | 26-27-28-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
Diphenylacetyl Chloride is a reagent used in the synthesis of β-lactam estrogen receptor antagonists promoting antiproliferative and anti-tubulin polymerizatiion activity.
제조 및 합성 방법
제조 방법
Diphenylacetyl Chloride is prepared by the action of Thionyl Chloride on diphenylacetic acid.