Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
p-Chlorophenethylic alcohol
4-Chlorophenethanol · 4-Chlorophenethylalc · Chlorophenyl ethanol · 4-Chlorophenylethanol · 4-chlorobenzeneethanol · P-CHLORO PHENYL ETHANOL · 4-chlorophenethylalchol · 4-CHLOROPHENETHYLALCOHOL
식별자 및 물리적 특성
| CAS No. | 1875-88-3 |
|---|---|
| 분자식 | C8H9ClO |
| 평균 분자량 | 156.61 g/mol |
| 단동위원소 질량 | 156.03419259 g/mol |
| SMILES | OCCc1ccc(Cl)cc1 |
| InChIKey | HZFRKZWBVUJYDA-UHFFFAOYSA-N |
| PubChem CID | 74647 |
| EC No. | 217-506-4 |
| DTXSID | DTXSID90172063 |
화학 및 물리적 성질
| XLogP | 1.4 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 87.3 |
| SpringerMaterials Properties | Boiling point |
| 끓는 점 | 110 °C/0.5 mmHg (lit.) |
| 밀도 | 1.157 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.548(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| pKa(산도 계수) | 14.79±0.10(Predicted) |
| 색상 | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C8H9ClO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | HZFRKZWBVUJYDA-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=C(Cl)C=C1 |
| NIST | 4-Chlorophenyl methyl carbinol(1875-88-3) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | WarningH302 (33.3%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (33.3%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29062990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |