Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-브로모페닐아세트산
3-브로모페닐아세트산 · 2-(3-bromophenyl)acetic acid · RARECHEM AL BO 0120 · Between broMine acid · 3-BROMOPHENYLACETIC ACID · M-BROMOPHENYLACETIC ACID · 3-Bromobenzeneacetic acid · (3-bromophenyl)acric acid
식별자 및 물리적 특성
| CAS No. | 1878-67-7 |
|---|---|
| 분자식 | C8H7BrO2 |
| 평균 분자량 | 215.04 g/mol |
| 단동위원소 질량 | 213.96294156 g/mol |
| SMILES | O=C(O)Cc1cccc(Br)c1 |
| InChIKey | KYNNBXCGXUOREX-UHFFFAOYSA-N |
| PubChem CID | 74653 |
| ChEMBL | CHEMBL139276 |
| EC No. | 217-522-1 |
| DTXSID | DTXSID0075152 |
| 현지명 | 3-브로모페닐아세트산 |
화학 및 물리적 성질
| XLogP | 2.4 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 147 |
| LogP(분배 계수) | 2.37 |
| 녹는점 | 98-102 °C (lit.) |
| 끓는 점 | 252.95°C (rough estimate) |
| 밀도 | 1.5313 (rough estimate) |
| 굴절률 | 1.5500 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | DMSO및메탄올에 용해됨 |
| 물리적 상태 | 결정질 분말 또는 바늘 |
| pKa(산도 계수) | 4.12±0.10(Predicted) |
| 색상 | 하얀색 |
| BRN | 2045104 |
| InChI | InChI=1S/C8H7BrO2/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2,(H,10,11) |
| InChIKey | KYNNBXCGXUOREX-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(Br)=C1 |
| NIST | 3-Bromophenylacetic acid(1878-67-7) |
| EPA | 3-Bromophenylacetic acid (1878-67-7) |
화학적 성질
white crystalline powder or needles
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 16.7% (1 of 6) of reports.DangerH314 (16.7%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (16.7%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25 |
| 위험 등급 | IRRITANT |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
3-Bromophenylacetic Acid is a halo substituted phenylacetic acid with anti oxidative properties. 3-Bromophenylacetic Acid has been shown to inhibit penicillin biosynthetic enzymes.