Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Chloro-5-nitropyrimidin-4-amine
4-AMINO-2-CHLORO-5-NITROPYRIMIDINE · KML-51 · IFLAB-BB F1930-0037 · nitropyrimidin-1-(2-prop-2-enoxyethoxy)butane · 2-CHLORO-5-NITRO-4-PYRIMIDINAMINE · 2-Chloro-5-nitropirimidin-4-amine · 2-Chloro-5-nitropyrimidin-4-amine · 2-Chloro-5-nitropyrimidine-4-amine
식별자 및 물리적 특성
| CAS No. | 1920-66-7 |
|---|---|
| 분자식 | C4H3ClN4O2 |
| 평균 분자량 | 174.54 g/mol |
| 단동위원소 질량 | 173.99445302 g/mol |
| SMILES | Nc1nc(Cl)ncc1[N+](=O)[O-] |
| InChIKey | RZGOEIWDMVQJBQ-UHFFFAOYSA-N |
| PubChem CID | 74716 |
| EC No. | 217-648-7 |
| DTXSID | DTXSID00172756 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 97.6 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 161 |
| 녹는점 | 221-226 °C |
| 끓는 점 | 446.0±25.0 °C(Predicted) |
| 밀도 | 1.712±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| pKa(산도 계수) | -1.22±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 용해도 | 물에 약간 용해됩니다. |
| InChI | InChI=1S/C4H3ClN4O2/c5-4-7-1-2(9(10)11)3(6)8-4/h1H,(H2,6,7,8) |
| InChIKey | RZGOEIWDMVQJBQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C(N)=N1 |
화학적 성질
Yellow to brown solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P233, P260, P261, P264, P264+P265, P270, P271, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P342+P316, P362+P364, P403, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 22-36/37/38-43 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-36/37-36 |
| 위험 등급 | Acute Tox. 4 OralEye Irrit. 2Resp. Sens. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field.