Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
9-카르복시플루오렌
9-카르복시플루오렌 · 9H-FLUORENE-9-CARBOXYLIC ACID · 9-FLUORENECARBOXYLIC ACID · AKOS AUF02021 · FOR INDECAINIDE · 9-Carboxyfluoren · 9-Carboxyfluorene · uorene-9-carboxyL
식별자 및 물리적 특성
| CAS No. | 1989-33-9 |
|---|---|
| 분자식 | C14H10O2 |
| 평균 분자량 | 210.23 g/mol |
| 단동위원소 질량 | 210.06807956 g/mol |
| SMILES | O=C(O)C1c2ccccc2-c2ccccc21 |
| InChIKey | DNVJGJUGFFYUPT-UHFFFAOYSA-N |
| PubChem CID | 74809 |
| ChEMBL | CHEMBL295321 |
| EC No. | 217-866-2 |
| DTXSID | DTXSID6062098 |
| 현지명 | 9-카르복시플루오렌 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 264 |
| LogP(분배 계수) | 2.8 |
| 녹는점 | 228-231 °C(lit.) |
| 끓는 점 | 309.75°C (rough estimate) |
| 밀도 | 1.1307 (rough estimate) |
| 굴절률 | 1.5681 (estimate) |
| 인화점 | 230°C |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 4.59±0.20(Predicted) |
| 색상 | Faint beige |
| 용해도 | 불용성 |
| BRN | 1911728 |
| InChI | InChI=1S/C14H10O2/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13H,(H,15,16) |
| InChIKey | DNVJGJUGFFYUPT-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| NIST | 9H-fluorene-9-carboxylic acid(1989-33-9) |
| EPA | 9H-Fluorene-9-carboxylic acid (1989-33-9) |
화학적 성질
WHITE TO YELLOW CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | 9H-Fluorene-9-carboxylic acid: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 22-24/25-36/37/39-27-26 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
9H-Fluorene-9-carboxylic Acid, is a building block in the synthesis of various pharmaceutical and biologically active compounds. It is used in the synthesis of Lomitapide, a drug for the treatment of familial hypercholesterolemia.