Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N,N-Dimethyl-4-nitroaniline
4-Nitrodimethylaniline · p-Nitro-N,N-dimethylaniline · p-Nitrodimethylaniline · *Nintedanib Impurity 153 · N-Dimethyl-4-nitroaniline · n,n-dimethyl-p-nitro-anilin · 4-NITRO-N,N-DIMETHYLANILINE · N,N-DIMETHYL-P-NITROANILINE
식별자 및 물리적 특성
| CAS No. | 100-23-2 |
|---|---|
| 분자식 | C8H10N2O2 |
| 평균 분자량 | 166.18 g/mol |
| 단동위원소 질량 | 166.07422756 g/mol |
| SMILES | CN(C)c1ccc([N+](=O)[O-])cc1 |
| InChIKey | QJAIOCKFIORVFU-UHFFFAOYSA-N |
| PubChem CID | 7491 |
| ChEMBL | CHEMBL3098161 |
| EC No. | 202-832-1 |
| DTXSID | DTXSID4059209 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 49.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 157 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| LogP(분배 계수) | 2.27 |
| 녹는점 | 163-165 °C |
| 끓는 점 | 314.38°C (rough estimate) |
| 밀도 | 1.2275 (estimate) |
| 굴절률 | 1.6273 (estimate) |
| 인화점 | 161~162℃ |
| 저장 조건 | -20°C Freezer, Under inert atmosphere |
| 용해도 | 클로로포름 (약간 용해됨), 디클로로메탄 (약간 용해됨) |
| pKa(산도 계수) | 0.74±0.12(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 밝은 노란색에서 노란색까지 |
| 용해도 | 디클로로메탄에 용해됩니다. 물에 불용성. 뜨거운 메탄올에 대한 용해도(거의 투명함). |
| BRN | 638087 |
| EPA | Benzenamine, N,N-dimethyl-4-nitro- (100-23-2) |
화학적 성질
Yellow Solid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | BX7035000 |
| 운송 번호(UN) | 2811 |
| 독성 | rat,LD,oral,> 500mg/kg (500mg/kg),National Academy of Sciences, National Research Council, Chemical-Biological Coordination Center, Review. Vol. 5, Pg. 11, 1953. |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 36/37/38-23/24/25 |
| 위험 표시 | T |
| 안전 문구(S) | 45-36/37/39-26 |
| 포장분류 | III |
| 위험 등급 | 6.1 |
용도
용도
It is an aromatic intermediate and in the experimental and theoretical study of the structure of N,N-dimethyl-4-nitroaniline derivatives as model compounds for non-linear optical organic materials.