Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-(4-(4-Chlorophenyl)cyclohexyl)-4-hydroxynaphthalene-1,2-dione
cis-Atovaquone · cis-Atovaquone-d4 · Atovaquone EP Imp B · Atovaquone Impurity 17 · Atovaquone EP Impurity B · cis-Atovaquone (Racemic) · Atovaquone EP Impurity B (RC A) · Atovaquone Impurity 2（Atovaquone EP Impurity B）
식별자 및 물리적 특성
| CAS No. | 137732-39-9 |
|---|---|
| 분자식 | C22H19ClO3 |
| 평균 분자량 | 366.8 g/mol |
| 단동위원소 질량 | 366.10227215 g/mol |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1C1CCC(c2ccc(Cl)cc2)CC1 |
| InChIKey | BSJMWHQBCZFXBR-UHFFFAOYSA-N |
| PubChem CID | 74989 |
| ChEMBL | CHEMBL471792 |
| ChEBI | CHEBI:575568 |
| EC No. | 689-795-9 |
| DTXSID | DTXSID20916694 |
화학 및 물리적 성질
| XLogP | 5.2 |
|---|---|
| 극성 표면적 | 54.4 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 26 |
| 형식 전하 | 0 |
| 복잡도 | 595 |
| 의약품 | PharmaceuticalsPharmaceuticals -> Used in SwitzerlandPharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | 5.07 |
| Collision Cross Section | 172.05 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
| 녹는점 | >40°C (dec.) |
| 끓는 점 | 535.0±50.0 °C(Predicted) |
| 밀도 | 1.349±0.06 g/cm3(Predicted) |
| 저장 조건 | Room Temperature, under inert atmosphere |
| 용해도 | 클로로포름(약간 용해됨), 디클로로메탄(약간 용해됨, 아세토니트릴) |
| pKa(산도 계수) | 5.01±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 연한 노란색에서 밝은 노란색까지 |
| 주요 응용 | 의약품(소분자) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
cis-Atovaquone is the cis-isomer of Atovaquone (A793500), a hydroxynaphthoquinone derivative that inhibits mitochondrial electron transport.