Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3-Chloro-2-fluoroaniline
Benzenamine, 3-chloro-2-fluoro- · BUTTPARK 29\01-51 · TIMTEC-BB SBB004108 · Gefitinib Impurity 83 · 3-Chloro-2-fluoraniline · 3-CHLORO-2-FLUOROANILINE · 3-Chloro-2-fluoroaniline97% · 3-Chloro-2-fluoroaniline,98%
식별자 및 물리적 특성
| CAS No. | 2106-04-9 |
|---|---|
| 분자식 | C6H5ClFN |
| 평균 분자량 | 145.56 g/mol |
| 단동위원소 질량 | 145.00945506 g/mol |
| SMILES | Nc1cccc(Cl)c1F |
| InChIKey | XWBTZHDDWRNOQH-UHFFFAOYSA-N |
| PubChem CID | 75014 |
| EC No. | 218-283-6 |
| DTXSID | DTXSID0062183 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 99.1 |
| 끓는 점 | 214 °C (lit.) |
| 밀도 | 1.324 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.564(lit.) |
| 인화점 | 230 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | 투명한 액체 |
| pKa(산도 계수) | 2.15±0.10(Predicted) |
| 비중 | 1.34 |
| 색상 | 무색~갈색 |
| InChI | InChI=1S/C6H5ClFN/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 |
| InChIKey | XWBTZHDDWRNOQH-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=CC(Cl)=C1F |
| EPA | 3-Chloro-2-fluoroaniline (2106-04-9) |
화학적 성질
clear light beige liquid
안전 및 규제
| GHS 분류 | DangerH302 (96.2%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 52 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (96.2%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29214200 |
| 위험 문구(R) | 36/37/38-20/21/22-41-37/38-22-23/24/25 |
| 위험 표시 | Xi,T,Xn |
| 안전 문구(S) | 26-36-36/37/39-39-45 |
| 위험 등급 | 6.1Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Toxic |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
3-Chloro-2-fluoroaniline may be used in the preparation of 2-chloro-3-fluorobromobenzene and 4-((3-chloro-2-fluorophenyl)amino)-7-methoxyquinazolin-6-yl acetate.
일반 설명
3-Chloro-2-fluoroaniline is a dihalo-substituted aniline. Its enthalpy of vaporization at boiling point (487.15K) is 42.561kjoule/mol.