Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5,6-다이메톡시-1-인단온
5,6-다이메톡시-1-인단온 · 5,6-DIMETHOXYINDANONE · 2,3-Dihydro-5,6-dimethoxy-1H-inden-1-one · AB1007066 · AKOS 90805 · 5,6-Dimethoxy-1 · DiMethoxy-1-indan · 5,6-Dimethoxy-1-inda
식별자 및 물리적 특성
| CAS No. | 2107-69-9 |
|---|---|
| 분자식 | C11H12O3 |
| 평균 분자량 | 192.21 g/mol |
| 단동위원소 질량 | 192.07864424 g/mol |
| SMILES | COc1cc2c(cc1OC)C(=O)CC2 |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| PubChem CID | 75018 |
| ChEMBL | CHEMBL611356 |
| EC No. | 218-287-8 |
| DTXSID | DTXSID9057680 |
| 현지명 | 5,6-다이메톡시-1-인단온 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 35.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| 녹는점 | 118120°C |
| 끓는 점 | 139 °C / 2mmHg |
| 밀도 | 1.1503 (rough estimate) |
| 굴절률 | 1.4600 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름, 에틸아세테이트에 용해됨 |
| 물리적 상태 | 고체 |
| 색상 | 황백색에서 연한 노란색 |
| BRN | 1241095 |
| InChI | InChI=1S/C11H12O3/c1-13-10-5-7-3-4-9(12)8(7)6-11(10)14-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | IHMQOBPGHZFGLC-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(OC)C(OC)=C2)CC1 |
| NIST | 1-Indanone, 5,6-dimethoxy-,(2107-69-9) |
| EPA | 1H-Inden-1-one, 2,3-dihydro-5,6-dimethoxy- (2107-69-9) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 28.6% (2 of 7) of reports.WarningH302 (71.4%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 7 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance. |
| Hazard Classes and Categories | Acute Tox. 4 (71.4%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2914390090 |
| 위험 문구(R) | 20/21/22-36/37/38-22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-24/25-36-26 |
| 기존화학 물질 | 2005-3-3172 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
5,6-Dimethoxy-1-indanone can be an intermediate useful in the preparation of Donepezil.
일반 설명
Thiosemicarbazone derived from 5,6-dimethoxy-1-indanone inhibits bovine viral diarrhea virus infection.