Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-(3-트리푸오로메틸)페닐-4-피페리디놀
4-(3-트리푸오로메틸)페닐-4-피페리디놀 · NSC 83235 · MLS000080732 · SMR000035341 · EINECS 216-863-3 · TIMTEC-BB SBB003184 · 4-(3-Trifluoromethylphenyl)-4- · 2-methylthiazole-25-carboxylic acid
식별자 및 물리적 특성
| CAS No. | 2249-28-7 |
|---|---|
| 분자식 | C12H14F3NO |
| 평균 분자량 | 245.24 g/mol |
| 단동위원소 질량 | 245.10274873 g/mol |
| SMILES | OC1(c2cccc(C(F)(F)F)c2)CCNCC1 |
| InChIKey | ILKPZCKFWLTEBQ-UHFFFAOYSA-N |
| PubChem CID | 75255 |
| ChEMBL | CHEMBL1624025 |
| EC No. | 218-840-3 |
| DTXSID | DTXSID50177014 |
| 현지명 | 4-(3-트리푸오로메틸)페닐-4-피페리디놀 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 32.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 261 |
| 녹는점 | 91-95 °C |
| 끓는 점 | 301°C |
| 밀도 | 1.253 |
| 인화점 | 136°C |
| 저장 조건 | 2-8°C, protect from light |
| 물리적 상태 | 미세 결정성 분말 |
| pKa(산도 계수) | 13.94±0.20(Predicted) |
| 색상 | 라이트 베이지 |
화학적 성질
LIGHT BEIGE FINE CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | WarningH302 (20%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 5 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (20%) |
| 관세 코드 | 29333999 |
| 위험 문구(R) | 36/37/38-22 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 37/39-26-36 |
용도
용도
4-[3-(Trifluoromethyl)phenyl]-4-piperidinol can be used to synthesize antagonists for CCR1 receptor. It can also be used to synthesize (bisarylmethoxy)butylpiperidine analogues as neurotransmitter transporter inhibitors. It is also an intermediate for xaliproden [135354-02-8].