Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
아세틸콜린아이오다이드
아세틸콜린아이오다이드 · 아세틸콜린요오드화물 · ACH · CEK2 · JTK4 · CD333 · HSFGFR3EX · acetylcolina
식별자 및 물리적 특성
| CAS No. | 2260-50-6 |
|---|---|
| 분자식 | C7H16INO2 |
| 평균 분자량 | 273.11 g/mol |
| 단동위원소 질량 | 273.02257675 g/mol |
| SMILES | CC(=O)OCC[N+](C)(C)C.[I-] |
| InChIKey | SMBBQHHYSLHDHF-UHFFFAOYSA-M |
| PubChem CID | 75271 |
| ChEMBL | CHEMBL60457 |
| EC No. | 218-862-3 |
| DTXSID | DTXSID10883821 |
| 현지명 | 아세틸콜린아이오다이드 |
화학 및 물리적 성질
| 극성 표면적 | 26.3 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 115 |
| 녹는점 | 161-164 °C |
| 밀도 | 1.4816 (estimate) |
| 저장 조건 | -20°C |
| 용해도 | DMSO에 용해됨 |
| 물리적 상태 | 결정성 분말 |
| 색상 | 하얀색 |
| 생물학적 소스 | rabbit |
| 용해도 | 거의 투명함 |
| BRN | 3571339 |
| Specific Activity | 95-129nmol/min·mg |
| InChI | 1S/C7H16NO2.HI/c1-7(9)10-6-5-8(2,3)4/h5-6H2,1-4H31H/q+1/p-1 |
| InChIKey | SMBBQHHYSLHDHF-UHFFFAOYSA-M |
| SMILES | [I-].CC(=O)OCC[N+](C)(C)C |
| EPA | Ethanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, iodide (2260-50-6) |
화학적 성질
WHITE CRYSTALLINE POWDER
안전 및 규제
| GHS 분류 | WarningH302 (81.6%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 기타 안전 정보 | IMAP assessments - Ethanaminium, 2-(acetyloxy)-N,N,N-trimethyl-, iodide: Environment tier I assessment |
| Hazard Classes and Categories | Acute Tox. 4 (81.6%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | KH3300000 |
| 관세 코드 | 29239000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| F 고인화성물질 | 8-9 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Acetylcholine is an endogenous neurotransmitter at cholinergic synapses that amplifies action potential of the sarcolemma thereby inducing muscle contractions. Acetylcholine iodide is used as an acetylcholine receptor agonist to identify, characterize and differentiate among types of cholinergic receptors. Acetylcholine iodide is used as a substrate to identify and characterize natural and mutated acetylcholinesterase(s).