Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,3-Difluoro-5-nitrobenzene
1,3-DIFLUORO-5-NITROBENZENE · 3,5-Difluoronitroben · 3,5-Difluornitrobenzene · 3,5-DIFLUORONITROBENZENE · Flurbiprofen Impurity 179 · 3,5-Difluoronitrobenzene>3,5-Difluoro-1-nitrobenzene · 1-Nitro-3,5-difluorobenzene · 3,5-Difluoronitrobenzene 99%
식별자 및 물리적 특성
| CAS No. | 2265-94-3 |
|---|---|
| 분자식 | C6H3F2NO2 |
| 평균 분자량 | 159.09 g/mol |
| 단동위원소 질량 | 159.01318478 g/mol |
| SMILES | O=[N+]([O-])c1cc(F)cc(F)c1 |
| InChIKey | AUQBBDWDLJSKMI-UHFFFAOYSA-N |
| PubChem CID | 75272 |
| EC No. | 218-867-0 |
| DTXSID | DTXSID30177193 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 45.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 149 |
| LogP(분배 계수) | 2.03 |
| 녹는점 | 17 °C (lit.) |
| 끓는 점 | 176-177 °C (lit.) |
| 밀도 | 1.407 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.499(lit.) |
| 인화점 | 165 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | Light yellow to Yellow to Orange |
| 비중 | 1.407 |
| 안정성 | 안정적인. 타기 쉬운. 강한 산화제, 강한 염기와 호환되지 않습니다. |
| InChI | 1S/C6H3F2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H |
| InChIKey | AUQBBDWDLJSKMI-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(F)cc(F)c1 |
화학적 성질
Clear yellow liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 3265 |
| 관세 코드 | 29049090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | IRRITANT, IRRITANT-HARMFULEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
3,5-Difluoronitrobenzene has been used to improve thermal stability of immobilized porcine pancrease lipase.
일반 설명
Molecular structure of 3,5-difluoronitrobenzene was studied by gas-phase electron diffraction, MP2 ab initio and by B3LYP density functional calculations.