Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-클로로-6-니트로벤조티아졸
2-클로로-6-니트로벤조티아졸 · 2-CHLORO-6-NITROBENZO[D]THIAZOLE · NSC 503418 · 6-Nitro-2-chlorobenzothiazole · 2-CHLORO-6-NITROBENZOTHIAZOLE · 2-chloro-6-nitrolbenzothiazole · Benzothiazole, 2-chloro-6-nitro- · 2-Chloro-6-nitrobenzothiazole,95%
식별자 및 물리적 특성
| CAS No. | 2407-11-6 |
|---|---|
| 분자식 | C7H3ClN2O2S |
| 평균 분자량 | 214.63 g/mol |
| 단동위원소 질량 | 213.96037602 g/mol |
| SMILES | O=[N+]([O-])c1ccc2nc(Cl)sc2c1 |
| InChIKey | KUCSJGBXJBQHNI-UHFFFAOYSA-N |
| PubChem CID | 75476 |
| ChEMBL | CHEMBL1213036 |
| EC No. | 219-302-0 |
| DTXSID | DTXSID90178803 |
| 현지명 | 2-클로로-6-니트로벤조티아졸 |
화학 및 물리적 성질
| XLogP | 3.4 |
|---|---|
| 극성 표면적 | 87 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 223 |
| 녹는점 | 192-195°C |
| 끓는 점 | 348.1±15.0 °C(Predicted) |
| 밀도 | 1.650±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -2.40±0.10(Predicted) |
| 색상 | 오프 화이트 |
| InChI | 1S/C7H3ClN2O2S/c8-7-9-5-2-1-4(10(11)12)3-6(5)13-7/h1-3H |
| InChIKey | KUCSJGBXJBQHNI-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2nc(Cl)sc2c1 |
화학적 성질
solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29342000 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |