Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-페닐-3-(트리플루오로메틸)아닐린
N-페닐-3-(트리플루오로메틸)아닐린 · NSC 50453 · Etofenamate EP Impurity C · m-Trifluoromethyldiphenylamine · 3-Trifluoromethyl diphenylamine · N-Phenyl-a,a,a-tri-fluorotoluidine · N-phenyl-3-(trifluoromethyl)aniline · Phenyl(m-trifluoromethylphenyl)amine
식별자 및 물리적 특성
| CAS No. | 101-23-5 |
|---|---|
| 분자식 | C13H10F3N |
| 평균 분자량 | 237.22 g/mol |
| 단동위원소 질량 | 237.07653398 g/mol |
| SMILES | FC(F)(F)c1cccc(Nc2ccccc2)c1 |
| InChIKey | WJCRAVDPIMWFPG-UHFFFAOYSA-N |
| PubChem CID | 7548 |
| EC No. | 202-926-2 |
| DTXSID | DTXSID30143616 |
| 현지명 | N-페닐-3-(트리플루오로메틸)아닐린 |
화학 및 물리적 성질
| XLogP | 4.3 |
|---|---|
| 극성 표면적 | 12 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 17 |
| 형식 전하 | 0 |
| 복잡도 | 233 |
| 끓는 점 | 108-110 °C(Press: 0.3 Torr) |
| 밀도 | 1+-.0.06 g/cm3(Predicted) |
| 굴절률 | 1.5655 (589.3 nm 25℃) |
| 저장 조건 | 2-8°C(protect from light) |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 기름 |
| pKa(산도 계수) | -0.36±0.30(Predicted) |
| 색상 | 무색 |
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P273, P280, P301+P317, P305+P351+P338, P330, P337+P317, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
N-Phenyl-3-(trifluoromethyl)aniline can be used as fungicides.