Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Ethanone, 1-(2,5-dichlorophenyl)-
1-(2,5-Dichlorophenyl)ethan-1-one · 2,5-DICHLOROACETOPHENONE · 1-(2,5-DICHLOROPHENYL)ETHANONE · Ketoconazole Impurity 34 · 2',5'-Dichloracetophenon · 2',5'-Dichloroactophenone · 2',5'-Dichloroacetophenon · 2',5'-Dichloroacetophenone
식별자 및 물리적 특성
| CAS No. | 2476-37-1 |
|---|---|
| 분자식 | C8H6Cl2O |
| 평균 분자량 | 189.04 g/mol |
| 단동위원소 질량 | 187.97957017 g/mol |
| SMILES | CC(=O)c1cc(Cl)ccc1Cl |
| InChIKey | CYNFEPKQDJHIMV-UHFFFAOYSA-N |
| PubChem CID | 75587 |
| ChEMBL | CHEMBL4636915 |
| EC No. | 219-605-8 |
| DTXSID | DTXSID2062452 |
화학 및 물리적 성질
| XLogP | 2.7 |
|---|---|
| 극성 표면적 | 17.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 158 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 11-13 °C(lit.) |
| 끓는 점 | 118 °C (12 mmHg) |
| 밀도 | 1.312 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.5624(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 액체 |
| 비중 | 1.312 |
| 색상 | 투명한 노란색에서 갈색을 띤다. |
| BRN | 1865043 |
| InChI | InChI=1S/C8H6Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-4H,1H3 |
| InChIKey | CYNFEPKQDJHIMV-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=CC=C1Cl)C |
| NIST | 2,5-Dichloroacetophenone(2476-37-1) |
| EPA | Ethanone, 1-(2,5-dichlorophenyl)- (2476-37-1) |
화학적 성질
clear yellow to brownish liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29147000 |
| 위험 문구(R) | 36/38-36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25-36-26-37-23 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
2′,5′-Dichloroacetophenone was used in the synthesis of 5-chloro-2-(2-thienylthio)acetophenone.
일반 설명
The standard molar enthalpy of formation of 2′,5′-dichloroacetophenone in the condensed phase was studied.