Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-클로로-3-클로로술포닐벤조산
4-클로로-3-클로로술포닐벤조산 · AKOS BBS-00007002 · Bumetanil impurity 4 · Indapamide Impurity D · Indapamide Impurity 17 · 4-chloro-3-(chlorosulfonyl)- · 4-CHLORO-3-CHLOROSULFONYLBENZOIC ACID · 4-chloro-3-chlorosulfonylbenzoci acid
식별자 및 물리적 특성
| CAS No. | 2494-79-3 |
|---|---|
| 분자식 | C7H4Cl2O4S |
| 평균 분자량 | 255.07 g/mol |
| 단동위원소 질량 | 253.9207352 g/mol |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)Cl)c1 |
| InChIKey | LYBQQYNSZYSUMT-UHFFFAOYSA-N |
| PubChem CID | 75613 |
| EC No. | 219-667-6 |
| DTXSID | DTXSID30179657 |
| 현지명 | 4-클로로-3-클로로술포닐벤조산 |
화학 및 물리적 성질
| XLogP | 2.1 |
|---|---|
| 극성 표면적 | 79.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 321 |
| 녹는점 | 170-172 °C |
| 끓는 점 | 60-80 °C |
| 밀도 | 1.694±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | DMSO(약간 용해됨), 에틸아세테이트(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 2.77±0.10(Predicted) |
| 색상 | 페일베이지부터 라이트베이지까지 |
| InChI | InChI=1S/C7H4Cl2O4S/c8-5-2-1-4(7(10)11)3-6(5)14(9,12)13/h1-3H,(H,10,11) |
| InChIKey | LYBQQYNSZYSUMT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C(S(Cl)(=O)=O)=C1 |
화학적 성질
Pale Beige Solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P264+P265, P270, P280, P301+P317, P305+P354+P338, P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 위험 문구(R) | 22-37/38-41 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-39 |
용도
용도
An intermediate of Indapamide (I500100), as bactericide, disinfectant, and antiseptic.