Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
3,5-Dichloroanthranilic acid
2-AMINO-3,5-DICHLOROBENZOIC ACID · BUTTPARK 49\07-46 · RARECHEM AL BO 0770 · TIMTEC-BB SBB003493 · Tafamidis Impurity 2 · LABOTEST-BB LT00241952 · 3,5-dichloro-anthranilicaci · 3,5-DICHLOROANTHRANILIC ACID
식별자 및 물리적 특성
| CAS No. | 2789-92-6 |
|---|---|
| 분자식 | C7H5Cl2NO2 |
| 평균 분자량 | 206.02 g/mol |
| 단동위원소 질량 | 204.96973376 g/mol |
| SMILES | Nc1c(Cl)cc(Cl)cc1C(=O)O |
| InChIKey | KTHTXLUIEAIGCD-UHFFFAOYSA-N |
| PubChem CID | 76036 |
| ChEMBL | CHEMBL2447899 |
| EC No. | 220-520-3 |
| DTXSID | DTXSID50182183 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 63.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 188 |
| SpringerMaterials Properties | Crystal structure |
| LogP(분배 계수) | 1.82 |
| 녹는점 | 227-230 °C(lit.) |
| 끓는 점 | 344.4±42.0 °C(Predicted) |
| 밀도 | 1.4062 (rough estimate) |
| 굴절률 | 1.6100 (estimate) |
| 저장 조건 | Storage temperature: no restrictions. |
| 용해도 | 아세트산(약간 용해됨, 가열), DMSO(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 4.20±0.10(Predicted) |
| 색상 | 흰색에서 연한 노란색 |
| 용해도 | 불용성 |
| BRN | 779100 |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12) |
| InChIKey | KTHTXLUIEAIGCD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC(Cl)=C1N |
화학적 성질
off-white to yellow to dark pink
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Benzoic acid, 2-amino-3,5-dichloro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | CB2800000 |
| 독성 | mouse,LD50,oral,1320mg/kg (1320mg/kg),BEHAVIORAL: EXCITEMENTLUNGS, THORAX, OR RESPIRATION: RESPIRATORY STIMULATION,Gigiena i Sanitariya. For English translation, see HYSAAV. Vol. 52(6), Pg. 85, 1987. |
| 관세 코드 | 29224985 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-36 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Amino-3,5-dichlorobenzoic acid, is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.