디시클로펜타디에닐 철
디시클로펜타디에닐철 · 페로센 · ermaotie · FERROCEN · BIS(CYCLOPENTADIENYL)IRON · BIS(CYCLOPENTADIEN)IRON · catane · Ferrotsen
식별자 및 물리적 특성
| CAS No. | 102-54-5 |
|---|---|
| 분자식 | C10H10Fe |
| 평균 분자량 | 186.03 g/mol |
| 단동위원소 질량 | 186.013186 g/mol |
| SMILES | [Fe+2].c1cc[cH-]c1.c1cc[cH-]c1 |
| InChIKey | KTWOOEGAPBSYNW-UHFFFAOYSA-N |
| PubChem CID | 7611 |
| 현지명 | 디시클로펜타디에닐 철 |
화학 및 물리적 성질
| 극성 표면적 | 0 |
|---|---|
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 11 |
| 녹는점 | 172-174 °C (lit.) |
| 끓는 점 | 249 °C (lit.) |
| 밀도 | 1.490 |
| 증기압 | 0.03 mm Hg ( 40 °C) |
| 인화점 | 100°C |
| 저장 조건 | Store below +30°C. |
| 용해도 | insoluble in H2Osoluble in ethanol, ethyl ether,benzene, dilute HNO 3 |
| 물리적 상태 | 수정 같은 |
| 색상 | 오렌지 레드 |
| 용해도 | 실질적으로 불용성 |
| Merck | 14,4037 |
| 안정성 | 실온에서 안정함. 강한 산화제와 호환되지 않습니다. 가연성이 높습니다. |
| InChI | 1S/2C5H5.Fe/c2*1-2-4-5-3-1/h2*1-5H |
| InChIKey | DFRHTHSZMBROSH-UHFFFAOYSA-N |
| SMILES | [Fe].[CH]1[CH][CH][CH][CH]1.[CH]2[CH][CH][CH][CH]2 |
| LogP(분배 계수) | 3.711 at 22℃ |
| NIST | Ferrocene(102-54-5) |
| EPA | Ferrocene (102-54-5) |
화학적 성질
Ferrocene, a metallocene, appears as bright orange salt-like crystals when crystallized from alcohol. It has a camphor-like odor and forms an orange crystalline solid. The compound is insoluble in water but soluble in benzene, ether, and alcohol, with an iron content of 29.4–30.6%.
안전 및 규제
| 직업 노출 등급(OEB) | B |
|---|---|
| 직업 노출 한계(OEL) | TWA: 10 mg/m3 (total) |
| 수질 위해 등급(WGK) | 2 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | LK0700000 |
| 운송 번호(UN) | UN 1325 4.1/PG 2 |
| 독성 | LD50 orally in Rabbit: 1320 mg/kg LD50 dermal Rat > 3000 mg/kg |
| 관세 코드 | 29310095 |
| 위험 문구(R) | 11-22-51/53-2017/11/22 |
| 위험 표시 | F,Xn,N |
| 안전 문구(S) | 61-22-24/25 |
| 포장분류 | II |
| 위험 등급 | 4.1Acute Tox. 4 InhalationAcute Tox. 4 OralAquatic Chronic 1Flam. Sol. 1Repr. 1BSTOT RE 2 Inhalation |
| 기존화학 물질 | 99-3-1231 |
| 자연 발화 온도 | >150 °C |
| 저장 분류 | 4.1B - Flammable solid hazardous materials |
| 유해 물질 데이터 | 102-54-5(Hazardous Substances Data) |
용도
용도
Ferrocene is used as a catalyst for vulcanization, acceleration, and polymerization, as a chemical intermediate for polymeric compounds such as high temperature polymers, as an antiknock additive for gasoline, as a coating for missiles and satellites, and as a high-temperature lubricant.
일반 설명
Ferrocene appears as orange crystalline solid or orange-yellow powder. Sublimes above 212 °F. Camphor odor. (NTP, 1992)
제조 및 합성 방법
생산 방법
Ferrocene is produced from the reaction of cyclopentadiene with reduced iron in the presence of metal oxides. There is also a two-stage production process in which produced iron (II)oxide (stage 1) is reacted with cyclopentadiene.