Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-메틸알릴아민
2-메틸알릴아민 · AKOS 91389 · METHALLYLAMINE · JACS-2878-14-0 · CH2=C(CH3)CH2NH2 · 2-METHYLALLYLAMINE · 2-Methylallylamine>2-Methylallylamine 98% · 2-Methylallylamine,97%
식별자 및 물리적 특성
| CAS No. | 2878-14-0 |
|---|---|
| 분자식 | C4H9N |
| 평균 분자량 | 71.12 g/mol |
| 단동위원소 질량 | 71.07349929 g/mol |
| SMILES | C=C(C)CN |
| InChIKey | VXDHQYLFEYUMFY-UHFFFAOYSA-N |
| PubChem CID | 76141 |
| EC No. | 220-724-2 |
| DTXSID | DTXSID80182954 |
| 현지명 | 2-메틸알릴아민 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 5 |
| 형식 전하 | 0 |
| 복잡도 | 38.9 |
| 끓는 점 | 78 °C |
| 밀도 | 0.78 |
| 굴절률 | 1.429-1.432 |
| 인화점 | -28 °C |
| 저장 조건 | 0-6°C |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 9.45±0.29(Predicted) |
| 색상 | 무색의 |
| InChI | InChI=1S/C4H9N/c1-4(2)3-5/h1,3,5H2,2H3 |
| InChIKey | VXDHQYLFEYUMFY-UHFFFAOYSA-N |
| SMILES | C(N)C(C)=C |
| NIST | 2-Propen-1-amine, 2-methyl-(2878-14-0) |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | DangerH225 (83.3%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 2 (83.3%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | 1992 |
| 관세 코드 | 29211990 |
| 위험 문구(R) | 36/37/38-11-36-22 |
| 위험 표시 | Xi-F,F,Xi,C,Xn |
| 안전 문구(S) | 37/39-26-16 |
| 포장분류 | II |
| 위험 등급 | FLAMMABLE, CORROSIVEAcute Tox. 4 OralEye Irrit. 2 |
| 위험 참고 사항 | Highly Flammable/Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2-Methylallylamine is an intermediate used in the synthesis of urea-containing FK506 binding protein inhibitors. It is also used to prepare benzothiazepine dioxides with HIV-1 protease inhibitory activities. It is dehydrogenated to methacrylonitrile over a silver catalyst. Copolymerization of methallylamine with acrylonitrile increases the affinity of polyacrylonitrile fibers for dyes.