Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
5-메톡시-2-메틸-3-인돌아세트산
5-메톡시-2-메틸-3-인돌아세트산 · NSC 97026 · 5-MeO,2-Me-IAA · VITAS-BB TBB000392 · TIMTEC-BB SBB003362 · Indomethacin USP RC A · Acemetacin Impurity 3 · Indomethacin Impurity B
식별자 및 물리적 특성
| CAS No. | 2882-15-7 |
|---|---|
| 분자식 | C12H13NO3 |
| 평균 분자량 | 219.24 g/mol |
| 단동위원소 질량 | 219.08954328 g/mol |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)O)c2c1 |
| InChIKey | TXWGINUZLBAKDF-UHFFFAOYSA-N |
| PubChem CID | 76151 |
| ChEMBL | CHEMBL1058 |
| ChEBI | CHEBI:172459 |
| EC No. | 220-734-7 |
| DTXSID | DTXSID00183009 |
| 현지명 | 5-메톡시-2-메틸-3-인돌아세트산 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 62.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 269 |
| 의약품 | Pharmaceuticals -> Metabolite of Acemetacin |
| 녹는점 | 161-163 °C (lit.) |
| 끓는 점 | 360.05°C (rough estimate) |
| 밀도 | 1.1825 (rough estimate) |
| 굴절률 | 1.5270 (estimate) |
| 저장 조건 | 2-8°C |
| 용해도 | 메탄올 에 용해됨 |
| pKa(산도 계수) | 4.22±0.30(Predicted) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 미색~연한 노란색 또는 연한 베이지색 |
| InChI | 1S/C12H13NO3/c1-7-9(6-12(14)15)10-5-8(16-2)3-4-11(10)13-7/h3-5,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | TXWGINUZLBAKDF-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c(C)c(CC(O)=O)c2c1 |
화학적 성질
slightly yellow fine crystalline powder
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 관세 코드 | 29349990 |
| 안전 문구(S) | 24/25 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
5-Methoxy-2-methyl-3-indoleacetic acid was used for quantitative determination of indomethacin and its major impurities in suppository and capsule formulations by HPLC. 5-Methoxy-2-methyl-3-indoleacetic acid was used in a study to develop fast, sensitive and simultaneous determination of metabolites of serotonin using liquid chromatography with mass spectrometric detection.
일반 설명
5-Methoxy-2-methyl-3-indoleacetic acid is hydrolysis product of indomethacin.