Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N-(2-옥소에틸)프탈이미드
N-(2-옥소에틸)프탈이미드 · 2-(1,3-DIOXOISOINDOLIN-2-YL)ACETALDEHYDE · NSC 30242 · PHTHALIMIDOACETALDEHYDE · N-(2-Formyl)phthalimide · Rucaparib Intermediate 1 · Phthalylglycine aldehyde · N-(2-OXOETHYL)PHTHALIMIDE
식별자 및 물리적 특성
| CAS No. | 2913-97-5 |
|---|---|
| 분자식 | C10H7NO3 |
| 평균 분자량 | 189.17 g/mol |
| 단동위원소 질량 | 189.04259308 g/mol |
| SMILES | O=CCN1C(=O)c2ccccc2C1=O |
| InChIKey | LMRDBJZQDUVCQH-UHFFFAOYSA-N |
| PubChem CID | 76201 |
| EC No. | 805-896-4 |
| DTXSID | DTXSID60183388 |
| 현지명 | N-(2-옥소에틸)프탈이미드 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 54.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 263 |
| 녹는점 | 116-118°C |
| 끓는 점 | 324.3±25.0 °C(Predicted) |
| 밀도 | 1.376±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,Store in freezer, under -20°C |
| 용해도 | 클로로포름(약간, 가열, 초음파 처리), 에틸아세테이트(약간)에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | -2.45±0.20(Predicted) |
| 색상 | 흰색에서 연한 노란색 |
| InChI | InChI=1S/C10H7NO3/c12-6-5-11-9(13)7-3-1-2-4-8(7)10(11)14/h1-4,6H,5H2 |
| InChIKey | LMRDBJZQDUVCQH-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CC=O |
화학적 성질
Off-White Solid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 16.7% (1 of 6) of reports.DangerH302 (50%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 6 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (50%) |
| RTECS 번호 | TI5125000 |
| 관세 코드 | 2933998090 |
| 위험 등급 | IRRITANT |
용도
용도
Phthalimidoacetaldehyde (cas# 2913-97-5) is a compound useful in organic synthesis.