Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Dihydro-3,3-dimethyl-2H-pyran-2,6(3H)-dione
3,3-Dimethyldihydro-2H-pyran-2,6(3H)-dione · 3,3-dimethyloxane-2,6-dione · 3,3-dimethyltetrahydropyran-2,6-dione · 2,2-Dimethylglutaric anhydride · 2,2-Dimethylglutaric Anhydride >2,2-Dimethylglutaric anhydride,98% · 2,2-DIMETHYLGLUTARIC ANHYDRIDE 98% · 2,2-dimethylglutaric acid anhydride · ALPHA,ALPHA-DIMETHYLGLUTARIC ANHYDRIDE
식별자 및 물리적 특성
| CAS No. | 2938-48-9 |
|---|---|
| 분자식 | C7H10O3 |
| 평균 분자량 | 142.15 g/mol |
| 단동위원소 질량 | 142.06299418 g/mol |
| SMILES | CC1(C)CCC(=O)OC1=O |
| InChIKey | PAVNZLVXYJDFNR-UHFFFAOYSA-N |
| PubChem CID | 76247 |
| EC No. | 220-922-9 |
| DTXSID | DTXSID70183612 |
화학 및 물리적 성질
| XLogP | 0.8 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 181 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 34-38 °C (lit.) |
| 끓는 점 | 175-180 °C/60 mmHg (lit.) |
| 밀도 | 1.1643 (rough estimate) |
| 굴절률 | 1.4730 (estimate) |
| 인화점 | >230 °F |
| 물리적 상태 | powder to lump |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 117056 |
| InChI | InChI=1S/C7H10O3/c1-7(2)4-3-5(8)10-6(7)9/h3-4H2,1-2H3 |
| InChIKey | PAVNZLVXYJDFNR-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)CCC1(C)C |
화학적 성질
white crystals or crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29171990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |