Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Amino-5-methylbenzoic acid
5-METHYLANTHRANILIC ACID · NSC 50786 · NSC 39154 · Fluralaner-032 · 2-Amino-5-methyL · BUTTPARK 41\07-01 · 6-Amino-m-toluylsure · Cetilistat Impurity 6
식별자 및 물리적 특성
| CAS No. | 2941-78-8 |
|---|---|
| 분자식 | C8H9NO2 |
| 평균 분자량 | 151.16 g/mol |
| 단동위원소 질량 | 151.06332853 g/mol |
| SMILES | Cc1ccc(N)c(C(=O)O)c1 |
| InChIKey | NBUUUJWWOARGNW-UHFFFAOYSA-N |
| PubChem CID | 76255 |
| EC No. | 220-932-3 |
| DTXSID | DTXSID40183629 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 63.3 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 158 |
| 녹는점 | 175 °C (dec.) (lit.) |
| 끓는 점 | 273.17°C (rough estimate) |
| 밀도 | 1.2023 (rough estimate) |
| 굴절률 | 1.5810 (estimate) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 물리적 상태 | 가루 |
| pKa(산도 계수) | 2.27±0.10(Predicted) |
| 색상 | 미색부터 베이지까지 |
| BRN | 1101527 |
| 주요 응용 | 펩타이드 합성 |
| InChI | InChI=1S/C8H9NO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | NBUUUJWWOARGNW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C)=CC=C1N |
| NIST | 2-Amino-5-methylbenzoic acid(2941-78-8) |
화학적 성질
Light-Brown Solid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29224999 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| F 고인화성물질 | 10 |
| 저장 분류 | 11 - Combustible Solids |