Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디메틸아니솔
1-Methoxy-2,3-dimethylbenzene · 3-METHOXY-O-XYLENE · 2,3-DIMETHYLANISOLE · 2,3-Dimethylanisole>2,3-DIMETHYLANISOLE 97% · 2,3-Dimethylanisole,97% · 1,2-Dimethyl-3-methoxybenzene · 1,2-Dimethyl-6-methoxybenzene · 2,3-DiMethylanisole, 97% 100GR
식별자 및 물리적 특성
| CAS No. | 2944-49-2 |
|---|---|
| 분자식 | C9H12O |
| 평균 분자량 | 136.19 g/mol |
| 단동위원소 질량 | 136.088815 g/mol |
| SMILES | COc1cccc(C)c1C |
| InChIKey | BLMBNEVGYRXFNA-UHFFFAOYSA-N |
| PubChem CID | 76269 |
| EC No. | 220-948-0 |
| DTXSID | DTXSID60183646 |
| 현지명 | 디메틸아니솔 |
화학 및 물리적 성질
| XLogP | 2.5 |
|---|---|
| 극성 표면적 | 9.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 101 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| 녹는점 | 29 °C(lit.) |
| 끓는 점 | 195 °C(lit.) |
| 밀도 | 0.984 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.52(lit.) |
| 인화점 | 155 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 물리적 상태 | powder to lump |
| 비중 | 0.984 |
| 색상 | 흰색에서 거의 흰색 |
| 용해도 | 섞일 수 없음 |
| BRN | 1859736 |
| InChI | InChI=1S/C9H12O/c1-7-5-4-6-9(10-3)8(7)2/h4-6H,1-3H3 |
| InChIKey | BLMBNEVGYRXFNA-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=CC(C)=C1C |
| LogP(분배 계수) | 3.211 (est) |
| NIST | 2,3-Dimethylanisole(2944-49-2) |
화학적 성질
clear light yellow liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29093090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-24/25 |
용도
용도
2,3-Dimethylanisole is used as starting reagent in the synthesis of biphenyl-indanone A, a positive allosteric modulator of the metabotropic glutamate receptor subtype 2. It can be used to produce 2-methoxy-6-methyl-benzaldehyde by heating.