Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,5-Difluorobenzoic acid
2,5-Difluorobenzoic · RARECHEM AL BO 0019 · 5-Difluorobenzoic acid · 2,5-Difluorobenzic acid · 2,5-Difuorobenzoic acid · 2,5-DIFLUOROBENZOIC ACID · 2,5-Difluorobenzoicacid98% · 2,5-Difluoro Benzoic Acids
식별자 및 물리적 특성
| CAS No. | 2991-28-8 |
|---|---|
| 분자식 | C7H4F2O2 |
| 평균 분자량 | 158.1 g/mol |
| 단동위원소 질량 | 158.01793581 g/mol |
| SMILES | O=C(O)c1cc(F)ccc1F |
| InChIKey | LBQMIAVIGLLBGW-UHFFFAOYSA-N |
| PubChem CID | 76339 |
| EC No. | 221-060-6 |
| DTXSID | DTXSID30184024 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 161 |
| 물질 분류 | Other Classes -> Benzoic Acid Derivatives |
| Physical Description | White, odorless crystalline powder[Alfa Aesar MSDS] |
| 녹는점 | 132-134 °C (lit.) |
| 끓는 점 | 244.7±20.0 °C(Predicted) |
| 밀도 | 1.3486 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 아세톤: 용해성25mg/mL, 투명하고 희미한 노란색 |
| pKa(산도 계수) | 2.93±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 하얀색 |
| 용해도 | 물에 불용성. |
| BRN | 973351 |
| InChI | InChI=1S/C7H4F2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H,10,11) |
| InChIKey | LBQMIAVIGLLBGW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(F)=CC=C1F |
| NIST | 2,5-Difluorobenzoic acid(2991-28-8) |
| EPA | Benzoic acid, 2,5-difluoro- (2991-28-8) |
화학적 성질
white crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | PMN - indicates a commenced PMN (Pre-Manufacture Notices) substance. |
| 유해성 요약 | A skin and strong eye irritant[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29163990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,5-Difluorobenzoic acid is used in the preparation of hydrazone derivatives, which acts as a potential antibacterial agent.
일반 설명
2,5-Difluorobenzoic acid has been quantitated in ground water samples by liquid chromatography-tandem mass spectrometry.