1H,1H,7H-도데카플루오로헵틸아크릴레이트
1H,1H,7H-도데카플루오로헵틸아크릴레이트 · 2,2,3,3,4,4,5,5,6,6,7,7-DODECAFLUOROHEPTYL ACRYLATE · 1H,1H,7H-Dodecafluoroheptyl · DFHA · DAIKIN R-5610 · TRIHYDROPERFLUOROHEPTYL ACRYLATE · 1H,1H,7H-PERFLUOROHEPTYL ACRYLATE · 1H,1H,7H-Perfluoroheptylacrylate98%
식별자 및 물리적 특성
| CAS No. | 2993-85-3 |
|---|---|
| 분자식 | C10H6F12O2 |
| 평균 분자량 | 386.13 g/mol |
| 단동위원소 질량 | 386.0176174 g/mol |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChIKey | QJEJDNMGOWJONG-UHFFFAOYSA-N |
| PubChem CID | 76340 |
| EC No. | 221-064-8 |
| DTXSID | DTXSID80184039 |
| 현지명 | 1H,1H,7H-도데카플루오로헵틸아크릴레이트 |
화학 및 물리적 성질
| XLogP | 4.9 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 14 |
| 회전 가능 결합 수 | 9 |
| 무거운 원자 수 | 24 |
| 형식 전하 | 0 |
| 복잡도 | 484 |
| PFAS | PFAS -> Other/unspecifiedPFAS -> OECD Category |
| SpringerMaterials Properties | Surface tension |
| 끓는 점 | 197 °C (lit.) |
| 밀도 | 1.581 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.342(lit.) |
| 인화점 | 215 °F |
| 저장 조건 | 2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | 무색 내지 거의 무색 |
| 비중 | 1.581 |
| BRN | 3563773 |
| InChI | InChI=1S/C10H6F12O2/c1-2-4(23)24-3-6(13,14)8(17,18)10(21,22)9(19,20)7(15,16)5(11)12/h2,5H,1,3H2 |
| InChIKey | QJEJDNMGOWJONG-UHFFFAOYSA-N |
| SMILES | C(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)(=O)C=C |
| EPA | (6H-Perfluorohexyl)methyl acrylate (2993-85-3) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | UD3340500 |
| 관세 코드 | 29161290 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 위험 등급 | 9Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Irritant/Keep Cold |
| 저장 분류 | 10 - Combustible liquids |
용도
용도
1H,1H,7H-Dodecafluoroheptyl Acrylate (CAS# 2993-85-3) is a polymerizable liquid crystal that can be used as an optically anisotropic film, optical film, polarizing plate, and image display device. It can also be used to produce particulate vinyliden-fluoride-based polymer.
일반 설명
2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoroheptyl acrylate (DFHA) is a fluorous functional monomer that is majorly used in the surface functionalization. It can also be utilized in chemical vapor deposition process for the synthesis of nanomaterials.