Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4,4′-디요오드비페닐
4,4′-디요오드비페닐 · 4,4'-Diiodo-1,1'-biphenyl · 4,4'-DIODOBIPHENYL · 4,4'-Diiodbiphenyl · 4,4'-diiidodiphenyl · 4,4'-Diiododiphenyl · 4,4'-Diiodobiphenyl · Biphenyl, 4,4'-diiodo
식별자 및 물리적 특성
| CAS No. | 3001-15-8 |
|---|---|
| 분자식 | C12H8I2 |
| 평균 분자량 | 406 g/mol |
| 단동위원소 질량 | 405.87154626 g/mol |
| SMILES | Ic1ccc(-c2ccc(I)cc2)cc1 |
| InChIKey | GPYDMVZCPRONLW-UHFFFAOYSA-N |
| PubChem CID | 76348 |
| EC No. | 221-080-5 |
| DTXSID | DTXSID5062766 |
| 현지명 | 4,4′-디요오드비페닐 |
화학 및 물리적 성질
| XLogP | 5.7 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 145 |
| Polymers | Other Classes -> Halogenated Polyaromatics |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Physical Description | Crystalline powder[Alfa Aesar MSDS] |
| 녹는점 | 201-204 °C(lit.) |
| 끓는 점 | 380.9±35.0 °C(Predicted) |
| 밀도 | 2.041±0.06 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 용해도 | 뜨거운 톨루엔(매우 희미한 탁도)에 용해됩니다. |
| 물리적 상태 | 가루 |
| 색상 | 연한 노란색~베이지색 |
| InChI | InChI=1S/C12H8I2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10/h1-8H |
| InChIKey | GPYDMVZCPRONLW-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(I)C=C2)=CC=C(I)C=C1 |
| NIST | 4,4'-Diiododiphenyl(3001-15-8) |
| EPA | 1,1'-Biphenyl, 4,4'-diiodo- (3001-15-8) |
화학적 성질
Crystalline powder
안전 및 규제
| GHS 분류 | WarningH302 (88.6%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | Induces drug metabolism enzymes. [ChemIDplus] An irritant[Alfa Aesar MSDS] See Biphenyl. See 4-Bromobiphenyl. |
| Hazard Classes and Categories | Acute Tox. 4 (88.6%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3152 9/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 20/21/22-37/38-36-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 36-37-26 |
| 포장분류 | II |
| 위험 등급 | 9Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 Oral |
| 기존화학 물질 | 2010-3-4549 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Intermediates of Liquid Crystals