식별자 및 물리적 특성
| CAS No. | 3002-54-8 |
|---|
| 분자식 | C6H5NdO7 |
|---|
| 평균 분자량 | 333.34 g/mol |
|---|
| 단동위원소 질량 | 330.9112508 g/mol |
|---|
| SMILES | O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Nd+3] |
|---|
| InChIKey | HSULNFGSJFUXON-UHFFFAOYSA-K |
|---|
| PubChem CID | 76356 |
|---|
| EC No. | 221-096-2 |
|---|
| DTXSID | DTXSID00184096 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 141 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 7 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 14 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 211 |
|---|
| 물질 분류 | Metals -> Rare Earth Metals |
|---|
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P264, P264+P265, P280, P302+P352, P305+P351+P338, P321, P332+P317, P337+P317, and P362+P364 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| 유해성 요약 | See RARE EARTH METALS and the linked occupational diseases. |
|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
|---|
| 유해 작용 | Fibrogenic - Inducing tissue injury and fibrosis (scarring). |
|---|
