Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-에틸벤조푸란
2-에틸벤조푸란 · ETHYLBENZOFURAN · 2-Ethylcoumarone · 2-Etyl Benzofuran · 2-ETHYLBENZOFURAN · 2-Ethylbenzofurane · Benzofuran, 2-ethyl- · 2-Ethyl-1-benzofuran
식별자 및 물리적 특성
| CAS No. | 3131-63-3 |
|---|---|
| 분자식 | C10H10O |
| 평균 분자량 | 146.19 g/mol |
| 단동위원소 질량 | 146.07316494 g/mol |
| SMILES | CCc1cc2ccccc2o1 |
| InChIKey | KJHYAEZMOHLVCH-UHFFFAOYSA-N |
| PubChem CID | 76582 |
| EC No. | 221-524-8 |
| DTXSID | DTXSID9062857 |
| 현지명 | 2-에틸벤조푸란 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 13.1 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 133 |
| 끓는 점 | 217-218 °C(Press: 742 Torr) |
| 밀도 | 1.050±0.06 g/cm3(Predicted) |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름(아껴서), 에틸아세테이트(아껴서)에 용해됨 |
| 물리적 상태 | 기름 |
| 색상 | 노란색 |
| InChI | InChI=1S/C10H10O/c1-2-9-7-8-5-3-4-6-10(8)11-9/h3-7H,2H2,1H3 |
| InChIKey | KJHYAEZMOHLVCH-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C=C1CC |
| LogP(분배 계수) | 3.955 (est) |
| NIST | Ethyl-2-benzofuran(3131-63-3) |
| EPA | Benzofuran, 2-ethyl- (3131-63-3) |
화학적 성질
Colorless to pale yellow transparent liquid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 50% (2 of 4) of reports.WarningH315 (50%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 4 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 12-01-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/33089 |
| Hazard Classes and Categories | Skin Irrit. 2 (50%) |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 2932990090 |