Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디프로모티오펜(2.3-)
2,3-다이브로모싸이오펜 · 디프로모티오펜(2.3-) · S0513 · NSC 99003 · AKOS 91257 · 2,3-Dibromthiophen · BUTTPARK 146\50-38 · 2,3-DIBROMOTHIOPHENE
식별자 및 물리적 특성
| CAS No. | 3140-93-0 |
|---|---|
| 분자식 | C4H2Br2S |
| 평균 분자량 | 241.93 g/mol |
| 단동위원소 질량 | 239.8244 g/mol |
| SMILES | Brc1ccsc1Br |
| InChIKey | ATRJNSFQBYKFSM-UHFFFAOYSA-N |
| PubChem CID | 76590 |
| EC No. | 221-542-6 |
| DTXSID | DTXSID80185324 |
| 현지명 | 디프로모티오펜(2.3-) |
화학 및 물리적 성질
| XLogP | 3.5 |
|---|---|
| 극성 표면적 | 28.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 66 |
| Kovats Retention Index | 1227 |
| 녹는점 | -17.5°C |
| 끓는 점 | 218-219 °C (lit.) |
| 밀도 | 2.137 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.632(lit.) |
| 인화점 | 125 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,2-8°C |
| 물리적 상태 | 액체 |
| 비중 | 2.137 |
| 색상 | White to Yellow to Green |
| BRN | 107512 |
| InChI | InChI=1S/C4H2Br2S/c5-3-1-2-7-4(3)6/h1-2H |
| InChIKey | ATRJNSFQBYKFSM-UHFFFAOYSA-N |
| SMILES | C1(Br)SC=CC=1Br |
| NIST | Thiophene, 2,3-dibromo-(3140-93-0) |
화학적 성질
clear yellowish to brownish liquid
안전 및 규제
| GHS 분류 | DangerH226 (91.7%): Flammable liquid and vapor [Warning Flammable liquids]H301 (85.4%): Toxic if swallowed [Danger Acute toxicity, oral]H315 (16.7%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (97.9%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P210, P233, P240, P241, P242, P243, P264, P264+P265, P270, P280, P301+P316, P302+P352, P303+P361+P353, P305+P351+P338, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies.Information may vary between notifications depending on impurities, additives, and other factors. The percentage value in parenthesis indicates the notified classification ratio from companies that provide hazard codes. Only hazard codes with percentage values above 10% are shown. For more detailed information, please visit ECHA C&L website. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (91.7%)Acute Tox. 3 (85.4%)Skin Irrit. 2 (16.7%)Eye Irrit. 2A (97.9%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1993 3/PG 3 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 10-36/37/38-20/21/22-36-25 |
| 위험 표시 | Xn,F,Xi,T |
| 안전 문구(S) | 23-24/25-36/37/39-26-16-36-45 |
| 포장분류 | III |
| 위험 등급 | 3Acute Tox. 3 OralEye Irrit. 2Flam. Liq. 3 |
| F 고인화성물질 | 8 |
| 위험 참고 사항 | Flammable/Irritant |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
2,3-Dibromothiophene (cas# 3140-93-0) is a compound useful in organic synthesis.