Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-히드록시-3-니트로벤조니트릴
4-히드록시-3-니트로벤조니트릴 · 2-NITRO-4-CYANOPHENOL · 4-CYANO-2-NITROPHENOL · 4-cyano-2-nitrophenolate · 4-HYDROXY-3-NITROBENZONITRILE · 3-Nitro-4-hydroxybenzonitrile · Benzonitrile, 4-hydroxy-3-nitro- · 4-HYDROXY-3-NITROBENZONITRILE 97%
식별자 및 물리적 특성
| CAS No. | 3272-08-0 |
|---|---|
| 분자식 | C7H4N2O3 |
| 평균 분자량 | 164.12 g/mol |
| 단동위원소 질량 | 164.02219199 g/mol |
| SMILES | N#Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChIKey | INBLGVOPOSGVTA-UHFFFAOYSA-N |
| PubChem CID | 76758 |
| EC No. | 221-899-8 |
| DTXSID | DTXSID60186394 |
| 현지명 | 4-히드록시-3-니트로벤조니트릴 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 89.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 12 |
| 형식 전하 | 0 |
| 복잡도 | 227 |
| SpringerMaterials Properties | 13C nuclear magnetic resonance spectrum |
| 녹는점 | 146-148 °C (lit.) |
| 끓는 점 | 291.56°C (rough estimate) |
| 밀도 | 1.5018 (rough estimate) |
| 굴절률 | 1.5300 (estimate) |
| 저장 조건 | Sealed in dry,Room Temperature |
| pKa(산도 계수) | 4.66±0.14(Predicted) |
| InChI | InChI=1S/C7H4N2O3/c8-4-5-1-2-7(10)6(3-5)9(11)12/h1-3,10H |
| InChIKey | INBLGVOPOSGVTA-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(O)C([N+]([O-])=O)=C1 |
화학적 성질
yellow powder
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzonitrile, 4-hydroxy-3-nitro- |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn |
| 안전 문구(S) | 26-37/39-36/37/39-24/25 |
| 위험 등급 | Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Hydroxy-3-nitrobenzonitrile may be used in the synthesis of:3-azido-4-methoxybenzonitrile4-methoxy-3-nitrobenzonitrileethyl [2,2-dimethyl-6-(Δ2-thiazolin-2-yl)-4H-l,4-benzoxazin-3-one-4-yl]butyrate
일반 설명
4-Hydroxy-3-nitrobenzonitrile is one of the main photoproduct formed during hotolytic destruction of herbicide bromoxynil.