Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,6-Dimethoxy-4-aminopyrimidine
I4-AMino-2,6-DiMethoxy PyriMidine · 4-Amino-2,6-dimethoxy · 2,6-dimethoxy-4-pyrimidinamin · 2,6-dimethoxypyrimidin-4-amin · 2,6-DIMETHOXYPYRIMIDIN-4-AMINE · Sulfadimethoxine EP Impurity A · 4-amino-2,6-dlmethoxypyrimidine · 4-Amino-4,6-dimethoxypyrimidine
식별자 및 물리적 특성
| CAS No. | 3289-50-7 |
|---|---|
| 분자식 | C6H9N3O2 |
| 평균 분자량 | 155.15 g/mol |
| 단동위원소 질량 | 155.06947653 g/mol |
| SMILES | COc1cc(N)nc(OC)n1 |
| InChIKey | LNTJJKHTAZFVJJ-UHFFFAOYSA-N |
| PubChem CID | 76789 |
| EC No. | 221-946-2 |
| DTXSID | DTXSID2062959 |
화학 및 물리적 성질
| XLogP | 0.5 |
|---|---|
| 극성 표면적 | 70.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 122 |
| 녹는점 | 149-152 °C (lit.) |
| 끓는 점 | 340.1±45.0 °C(Predicted) |
| 밀도 | 1.229±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2–8 °C |
| 용해도 | 메탄올: 용해성25mg/mL, 투명, 무색~노란색 |
| pKa(산도 계수) | 3.35±0.10(Predicted) |
| 물리적 상태 | 수정 같은 |
| 색상 | 하얀색 |
| InChI | InChI=1S/C6H9N3O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3,(H2,7,8,9) |
| InChIKey | LNTJJKHTAZFVJJ-UHFFFAOYSA-N |
| SMILES | C1(OC)=NC(OC)=CC(N)=N1 |
| EPA | 4-Pyrimidinamine, 2,6-dimethoxy- (3289-50-7) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 68 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29335990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39 |
| 위험 등급 | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 기존화학 물질 | KE-11027 |
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
4-Amino-2,6-dimethoxypyrimidine is methoxy substituted 4-aminopyrimidine. Molecules of 4-amino-2,6-dimethoxypyrimidine are linked by an N-H.O hydrogen bond and an N-H.N hydrogen bond, forming sheets containing centrosymmetric rings. Photocatalytic degradation of 4-amino-2,6-dimethoxypyrimidine on TiO2 has been reported. Mass spectra of 4-amino-2,6-dimethoxypyrimidine has been studied.