식별자 및 물리적 특성
| CAS No. | 29771-70-8 |
|---|
| 분자식 | C16H16Cl2N2O |
|---|
| 평균 분자량 | 323.2 g/mol |
|---|
| 단동위원소 질량 | 322.0639685 g/mol |
|---|
| SMILES | CC(C)c1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
|---|
| InChIKey | OVKTVOZVCAFCDU-UHFFFAOYSA-N |
|---|
| PubChem CID | 768108 |
|---|
| EC No. | 683-773-2 |
|---|
| DTXSID | DTXSID20354299 |
|---|
화학 및 물리적 성질
| XLogP | 5.8 |
|---|
| 극성 표면적 | 41.1 |
|---|
| 수소 결합 공여자 수 | 2 |
|---|
| 수소 결합 수용자 수 | 1 |
|---|
| 회전 가능 결합 수 | 3 |
|---|
| 무거운 원자 수 | 21 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 343 |
|---|
안전 및 규제
| GHS 분류 | WarningH400 (100%): Very toxic to aquatic life [Warning Hazardous to the aquatic environment, acute hazard]P273, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Aquatic Acute 1 (100%) |
|---|
