Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
부틸아민(4-노르말)
4-뷰틸아닐린 · 부틸아민(4-노르말) · 4-N-BUTYLANILINE · P-BUTYLANILINE · 4-BUTYLANILINE · 4-butyl-anilin · 4-N-Butyaniline · Butylaniline,98%
식별자 및 물리적 특성
| CAS No. | 104-13-2 |
|---|---|
| 분자식 | C10H15N |
| 평균 분자량 | 149.23 g/mol |
| 단동위원소 질량 | 149.12044948 g/mol |
| SMILES | CCCCc1ccc(N)cc1 |
| InChIKey | OGIQUQKNJJTLSZ-UHFFFAOYSA-N |
| PubChem CID | 7694 |
| ChEMBL | CHEMBL3181902 |
| EC No. | 203-177-4 |
| DTXSID | DTXSID8021856 |
| 현지명 | 부틸아민(4-노르말) |
화학 및 물리적 성질
| XLogP | 3 |
|---|---|
| 극성 표면적 | 26 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 93 |
| Collision Cross Section | 149.8 Ų [M+H]+ [CCS Type: DTBuffer gas: N2Ionization: ESI+Dataset: TOXCASTSource Identifier: DTXSID8021856] |
| 녹는점 | -14°C |
| 끓는 점 | 133-134 °C14 mm Hg(lit.) |
| 밀도 | 0.945 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.535(lit.) |
| 인화점 | 215 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | 4.91±0.10(Predicted) |
| 색상 | 투명한 노란색에서 약간 갈색까지 |
| BRN | 1447268 |
| InChI | InChI=1S/C10H15N/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8H,2-4,11H2,1H3 |
| InChIKey | OGIQUQKNJJTLSZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(CCCC)C=C1 |
| NIST | Benzenamine, 4-butyl-(104-13-2) |
| EPA | p-Butylaniline (104-13-2) |
화학적 성질
Orange liquid
안전 및 규제
| GHS 분류 | DangerH301+H311+H331 (85.1%): Toxic if swallowed, in contact with skin or if inhaled [Danger Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P262, P264, P264+P265, P270, P271, P273, P280, P301+P316, P301+P317, P302+P352, P304+P340, P305+P351+P338, P316, P319, P321, P330, P332+P317, P337+P317, P361+P364, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzenamine, 4-butyl-Benzenamine, 4-butyl-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 3 (85.1%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | BW9470000 |
| 운송 번호(UN) | UN 2810 6.1/PG 3 |
| 독성 | mouse,LD50,intraperitoneal,81mg/kg (81mg/kg),Journal of Medicinal Chemistry. Vol. 17, Pg. 900, 1974. |
| 관세 코드 | 29214980 |
| 위험 문구(R) | 23/24/25-36/37/38 |
| 위험 표시 | T |
| 안전 문구(S) | 23-26-36/37/39-45 |
| 위험 등급 | Acute Tox. 3 DermalAcute Tox. 3 InhalationAcute Tox. 3 OralAquatic Chronic 3Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
4-Butylaniline is used in the fabrication of RP/ion-exchange, mixed-mode, monolithic materials for capillary LC.