Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Phenyl-2-(phenylsulphonyl)ethan-1-one
TIMTEC-BB SBB009912 · 2-BENZENESULFONYLACETOPHENONE · (Phenylsulfonylacetyl)benzene · 2-(PHENYLSULFONYL)ACETOPHENONE · à-(benzenesulfonyl)acetophenone · 2-Oxo-2-phenylethylphenyl sulfone · Acetophenone, 2-(phenylsulfonyl)- · ALPHA-(PHENYLSULFONYL)ACETOPHENONE
식별자 및 물리적 특성
| CAS No. | 3406-03-9 |
|---|---|
| 분자식 | C14H12O3S |
| 평균 분자량 | 260.31 g/mol |
| 단동위원소 질량 | 260.05071524 g/mol |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChIKey | DREVPGKOIZVPQV-UHFFFAOYSA-N |
| PubChem CID | 76949 |
| ChEMBL | CHEMBL379738 |
| EC No. | 222-292-0 |
| DTXSID | DTXSID20187660 |
화학 및 물리적 성질
| XLogP | 2.6 |
|---|---|
| 극성 표면적 | 59.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 18 |
| 형식 전하 | 0 |
| 복잡도 | 368 |
| SpringerMaterials Properties | Chemical shift |
| LogP(분배 계수) | 1.86 |
| 녹는점 | 93-95 °C(lit.) |
| 끓는 점 | 373.57°C (rough estimate) |
| 밀도 | 1.2959 (rough estimate) |
| 굴절률 | 1.5050 (estimate) |
| 저장 조건 | Storage temp. 2-8°C |
| 용해도 | 벤젠에 용해됨 |
| 물리적 상태 | powder to crystal |
| 색상 | White to Orange to Green |
| BRN | 1879574 |
화학적 성질
light yellow crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-37/39-24/25 |
| 위험 등급 | IRRITANT |
| 기존화학 물질 | KE-28412 |