Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-Bromobenzyl bromide
1-Bromo-2-(bromomethyl)benzene · ,2-Dibromotoluene · à,2-dibromotoluene · α,o-Dibromotoluene · A,O-DIBROMOTOLUENE · methyl brombromide · O-BROMOBENZYL BROMIDE · 2-BROMOBENZYL BROMIDE
식별자 및 물리적 특성
| CAS No. | 3433-80-5 |
|---|---|
| 분자식 | C7H6Br2 |
| 평균 분자량 | 249.93 g/mol |
| 단동위원소 질량 | 247.88362439 g/mol |
| SMILES | BrCc1ccccc1Br |
| InChIKey | LZSYGJNFCREHMD-UHFFFAOYSA-N |
| PubChem CID | 76965 |
| EC No. | 222-334-8 |
| DTXSID | DTXSID0063022 |
화학 및 물리적 성질
| XLogP | 3.2 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 0 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 83 |
| 물질 분류 | Other Classes -> Halogenated Monoaromatics |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| Physical Description | White to light yellow solidmp = 29-32 deg C[Alfa Aesar MSDS] |
| 녹는점 | 29-32 °C (lit.) |
| 끓는 점 | 129 °C/19 mmHg (lit.) |
| 밀도 | 1.8246 (rough estimate) |
| 굴절률 | n20/D 1.619(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Inert atmosphere,Room Temperature |
| 용해도 | 디옥산: 용해성1g/10mL, 투명, 무색 |
| 물리적 상태 | 녹은 후에 액체 |
| 색상 | 무색~황색으로 투명함 |
| 용해도 | 물에 불용성. |
| BRN | 971015 |
| InChI | InChI=1S/C7H6Br2/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | LZSYGJNFCREHMD-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC=C1CBr |
| NIST | Benzene, 1-bromo-2-(bromomethyl)-(3433-80-5) |
| EPA | 2-Bromobenzyl bromide (3433-80-5) |
화학적 성질
clear colorless to yellowish liquid after melting
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 49 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | 2-Bromobenzyl bromide: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | Causes burns and lachrymation[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 유해 작용 | Dermatotoxin - Skin burns. |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3261 8/PG 3 |
| 관세 코드 | 29036990 |
| 위험 문구(R) | 34-37-23 |
| 위험 표시 | C,T |
| 안전 문구(S) | 26-36/37/39-45-22 |
| 포장분류 | III |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| F 고인화성물질 | 8-19 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
2-Bromobenzyl bromide was used in the synthesis of substituted quinazolines and 1,2,3,4-tetrahydroquinazolines, 2- and 3-substituted indenes, tris-2-bromotribenzylamine3.