Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-피렌부틸산
1-피렌부틸산 · PyBA · Pyrenebutyric acid · NSC 30833 · 1-pyrenebutyrate · Pyrenebutyric aci · Pyren-1-buttersure · 1-PYRENEBUTYRIC ACID
식별자 및 물리적 특성
| CAS No. | 25338-56-1 |
|---|---|
| 분자식 | C20H16O2 |
| 평균 분자량 | 288.3 g/mol |
| 단동위원소 질량 | 288.11502975 g/mol |
| SMILES | O=C(O)CCCc1ccc2ccc3cccc4ccc1c2c34 |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| PubChem CID | 76977 |
| ChEMBL | CHEMBL1484333 |
| EC No. | 222-354-7 |
| DTXSID | DTXSID4063032 |
| 현지명 | 1-피렌부틸산 |
화학 및 물리적 성질
| XLogP | 5.1 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 22 |
| 형식 전하 | 0 |
| 복잡도 | 418 |
| Polymers | Other Classes -> Polycyclic Aromatic Hydrocarbons |
| Physical Description | Light brown powder[Sigma-Aldrich MSDS] |
| 녹는점 | 184-186 °C (lit.) |
| 끓는 점 | 370.57°C (rough estimate) |
| 밀도 | 1.1742 (rough estimate) |
| 굴절률 | 1.4800 (estimate) |
| 저장 조건 | Store below +30°C. |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨, 가열) |
| 물리적 상태 | 결정성 분말 |
| pKa(산도 계수) | 4.76±0.10(Predicted) |
| 색상 | 연한 노란색 또는 노란색-베이지색 |
| 용해도 | 물에 부분적으로 용해됩니다. |
| BRN | 2140554 |
| InChI | InChI=1S/C20H16O2/c21-18(22)6-2-3-13-7-8-16-10-9-14-4-1-5-15-11-12-17(13)20(16)19(14)15/h1,4-5,7-12H,2-3,6H2,(H,21,22) |
| InChIKey | QXYRRCOJHNZVDJ-UHFFFAOYSA-N |
| SMILES | C1(CCCC(O)=O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
| EPA | 1-Pyrenebutanoic acid (3443-45-6) |
화학적 성질
Pale yellow or yellow-beige crystalline powder
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | A skin and strong eye irritant[Sigma-Aldrich MSDS] See Pyrene. |
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3077 9/PG 3 |
| 관세 코드 | 2916 39 90 |
| 위험 문구(R) | 36/37/38-50 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36-61 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
1-Pyrenebutyric acid (PBA) is a conjugated polymer that has a large π system and a carboxylic group. It is majorly used in surface functionalization. It has a high fluorescence efficiency and stability that make it useful in optoelectronic applications.