Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1-Bromo-4-(methylsulphonyl)benzene
4-Bromophenyl · NSC 174742 · TIMTEC-BB SBB006294 · 4-Bromo phenyl methyl · 4-BROMOPHENYL METHYL SULFON · Methyl 4-Bromophenylsulfone · 4-Bromophenyl methylesulfone · P-METHYL BENZENESULFOBROMIDE
식별자 및 물리적 특성
| CAS No. | 3466-32-8 |
|---|---|
| 분자식 | C7H7BrO2S |
| 평균 분자량 | 235.1 g/mol |
| 단동위원소 질량 | 233.93501256 g/mol |
| SMILES | CS(=O)(=O)c1ccc(Br)cc1 |
| InChIKey | FJLFSYRGFJDJMQ-UHFFFAOYSA-N |
| PubChem CID | 77014 |
| EC No. | 222-421-0 |
| DTXSID | DTXSID20188218 |
화학 및 물리적 성질
| XLogP | 1.1 |
|---|---|
| 극성 표면적 | 42.5 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 11 |
| 형식 전하 | 0 |
| 복잡도 | 209 |
| 녹는점 | 103-107 °C (lit.) |
| 끓는 점 | 348.6±34.0 °C(Predicted) |
| 밀도 | 1.595±0.06 g/cm3(Predicted) |
| 저장 조건 | Store at room temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 결정 또는 결정성 분말 |
| 색상 | 하얀색 |
| BRN | 2045675 |
| InChI | InChI=1S/C7H7BrO2S/c1-11(9,10)7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | FJLFSYRGFJDJMQ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(S(C)(=O)=O)C=C1 |
화학적 성질
Whitetolightyellowcrystalspowe
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29309090 |
| 위험 문구(R) | 22-36/37/38 |
| 위험 표시 | Xn,Xi |
| 안전 문구(S) | 22-24/25-36/37/39-26 |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
4-Bromophenyl methyl sulfone may be used to synthesize:biaryl methyl sulfones5-[[-4-(methylsulfonyl)phenyl]thio]thiophene-2-sulfonamide1-[4-(methylsulfonyl)phenyl]-1H-pyrazole (Hmsppz)DuP 697 via reaction with (5-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)trimethylsilane4-Bromophenyl methyl sulfone (1-bromo-4-(methylsulfonyl)benzene) can undergo coupling reaction with benzene sulfonamide in the presence of copper(I)iodide to form the corresponding N-aryl sulfonamide.