Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,3-Propanediol, 2-methylene-
2-methylenepropane-1,3-diol · 2-Methylene-1 · 2-methylene-3-propanediol · 1-（4-pyridinyl) acetone · 2-METHYLENE-1,3-PROPANEDIOL · 2-Methylidenepropane-1,3-diol · 1,3-Propanediol, 2-methylene- · 2-Methylene-1,3-propanediol>2-Methylene-1,3-propanediol 97%
식별자 및 물리적 특성
| CAS No. | 3513-81-3 |
|---|---|
| 분자식 | C4H8O2 |
| 평균 분자량 | 88.11 g/mol |
| 단동위원소 질량 | 88.0524295 g/mol |
| SMILES | C=C(CO)CO |
| InChIKey | JFFYKITVXPZLQS-UHFFFAOYSA-N |
| PubChem CID | 77048 |
| EC No. | 222-516-7 |
| DTXSID | DTXSID7063055 |
화학 및 물리적 성질
| XLogP | -0.4 |
|---|---|
| 극성 표면적 | 40.5 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 6 |
| 형식 전하 | 0 |
| 복잡도 | 43.5 |
| 끓는 점 | 93-95 °C/2 mmHg (lit.) |
| 밀도 | 1.081 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.473(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| pKa(산도 계수) | 14.14±0.10(Predicted) |
| 물리적 상태 | 점성 액체 |
| 색상 | 무색~담황색 투명 |
| BRN | 1737653 |
| InChI | InChI=1S/C4H8O2/c1-4(2-5)3-6/h5-6H,1-3H2 |
| InChIKey | JFFYKITVXPZLQS-UHFFFAOYSA-N |
| SMILES | C(O)C(=C)CO |
| EPA | 1,3-Propanediol, 2-methylene- (3513-81-3) |
화학적 성질
clear colorless to pale yellow viscous liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 관세 코드 | 29053990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 기존화학 물질 | KE-23926 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 10 - Combustible liquids |