Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
메틸3-부테노에이트
메틸3-부테노에이트 · methyl but-3-enoate · but-3-enoic acid methyl ester · CH2=CHCH2C(O)OCH3 · Methyl 3-butenoate · METHYL VINYLACETATE · Methyl 3-butenoate 95% · 3-butenoicacid,methylester
식별자 및 물리적 특성
| CAS No. | 3724-55-8 |
|---|---|
| 분자식 | C5H8O2 |
| 평균 분자량 | 100.12 g/mol |
| 단동위원소 질량 | 100.0524295 g/mol |
| SMILES | C=CCC(=O)OC |
| InChIKey | GITITJADGZYSRL-UHFFFAOYSA-N |
| PubChem CID | 77314 |
| EC No. | 223-076-9 |
| DTXSID | DTXSID5063150 |
| 현지명 | 메틸3-부테노에이트 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 76.1 |
| 물질 분류 | Other Classes -> Esters, Other |
| SpringerMaterials Properties | Chemical shift |
| Physical Description | Clear colorless liquid[Sigma-Aldrich MSDS] |
| 녹는점 | -78.42°C (estimate) |
| 끓는 점 | 112 °C (lit.) |
| 밀도 | 0.939 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.409(lit.) |
| 인화점 | 60 °F |
| 저장 조건 | Storage temp. 2-8°C |
| 물리적 상태 | liquid |
| BRN | 1741732 |
| InChI | InChI=1S/C5H8O2/c1-3-4-5(6)7-2/h3H,1,4H2,2H3 |
| InChIKey | GITITJADGZYSRL-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)CC=C |
| LogP(분배 계수) | 0.839 (est) |
| NIST | Methyl 3-butenoate(3724-55-8) |
| EPA | 3-Butenoic acid, methyl ester (3724-55-8) |
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 3 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Chemical: 3-Butenoic acid, methyl ester |
| 기타 안전 정보 | Evaluation - Chemicals not considered for in depth evaluation - Not commercially active in Australia |
| 유해성 요약 | May cause irritation[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| 운송 번호(UN) | UN 3272 3/PG 2 |
| 위험 문구(R) | 11 |
| 위험 표시 | F |
| 안전 문구(S) | 16 |
| 포장분류 | II |
| 위험 등급 | 3.1Flam. Liq. 2 |
| 기존화학 물질 | KE-04102 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
Methyl 3-butenoate may be employed for the synthesis of dipeptide olefin isosteres using intermolecular olefin cross-metathesis.
일반 설명
Methyl 3-butenoate is an olefin ester. It is reported to undergo Iron carbonyl-promoted isomerization to afford α, β-unsaturated esters. It is one of the reaction products formed during flash vacuum thermolysis of ()-cocaine. The H2 and CH4 chemical ionization mass spectra of methyl 3-butenoate has been reported.