Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
펜클로임
펜클로임 · 4,6-DICHLORO-2-PHENYLPYRIMIDINE · Soft · SOFIT · enclorim · femclorim · FENCLORIM · NSC 27713
식별자 및 물리적 특성
| CAS No. | 3740-92-9 |
|---|---|
| 분자식 | C10H6Cl2N2 |
| 평균 분자량 | 225.07 g/mol |
| 단동위원소 질량 | 223.99080355 g/mol |
| SMILES | Clc1cc(Cl)nc(-c2ccccc2)n1 |
| InChIKey | NRFQZTCQAYEXEE-UHFFFAOYSA-N |
| PubChem CID | 77338 |
| ChEMBL | CHEMBL2447919 |
| ChEBI | CHEBI:81993 |
| EC No. | 609-426-7 |
| DTXSID | DTXSID90190843 |
| 현지명 | 펜클로임 |
화학 및 물리적 성질
| XLogP | 4.2 |
|---|---|
| 극성 표면적 | 25.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 173 |
| LogP(분배 계수) | 4.17 |
| 녹는점 | 92-93°C |
| 끓는 점 | 235.5±33.0 °C(Predicted) |
| 밀도 | 1.363±0.06 g/cm3(Predicted) |
| 저장 조건 | Inert atmosphere,2-8°C |
| 용해도 | 클로로포름(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | -4.69±0.30(Predicted) |
| 색상 | 황백색에서 연한 노란색 |
| 용해도 | Insoluble in water |
| BRN | 142293 |
| 헨리 상수 | 5.6×10-1 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| InChI | InChI=1S/C10H6Cl2N2/c11-8-6-9(12)14-10(13-8)7-4-2-1-3-5-7/h1-6H |
| InChIKey | NRFQZTCQAYEXEE-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=NC(Cl)=CC(Cl)=N1 |
화학적 성질
White to off-white solid
안전 및 규제
| GHS 분류 | DangerH317 (98.6%): May cause an allergic skin reaction [Warning Sensitization, Skin]P261, P264+P265, P271, P272, P273, P280, P302+P352, P304+P340, P305+P354+P338, P317, P321, P333+P317, P362+P364, P391, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 71 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Sens. 1 (98.6%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | UV8258400 |
| 운송 번호(UN) | 3077 |
| 관세 코드 | 2933.59.1000 |
| 위험 문구(R) | 20-43 |
| 위험 표시 | Xn |
| 안전 문구(S) | 36/37 |
| 포장분류 | III |
| 위험 등급 | 9 |
| 기존화학 물질 | 97-3-109 |
용도
개요
Fenclorim (4,6-dichloro-2-phenylpyrimidine) is a pyrimidine herbicide safener that effectively protects rice (Oryza sativa L.) from the phytotoxicity of certain herbicides. It improves rice tolerance to chloroacetanilide herbicides by enhancing the expression of detoxifying glutathione S-transferase (GST). Compared with seed treatment with safener alone, sequential seed treatment with safener and insecticide minimizes the release of fenclorim without causing residue problems in the ecosystem and harvested rice.
용도
Herbicide safener.