Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
9-메톡시-2,3-디히드로푸로[3,2-G]쿠마린
9-메톡시-2,3-디히드로푸로[3,2-G]쿠마린 · 2,3-dihydroxanthotoxin · 4',5'-Dihydro-8-methoxypsoralen · 9-METHOXY-2,3-DIHYDROFURO[3,2-G]COUMARIN · 9-Methoxy-2H-furo[3,2-g]chroMen-7(3H)-one · 2-g][1]benzopyran-7-one,2,3-dihydro-9-methoxy-7h-furo[ · 2,3-dihydro-9-methoxy-7H-furo[3,2-g][1]benzopyran-7-one · 9-Methoxy-2,3-dihydro-7H-furo[3,2-g][1]benzopyran-7-one
![9-메톡시-2,3-디히드로푸로[3,2-G]쿠마린 분자 구조식](/img/chemical/77409.png)
식별자 및 물리적 특성
| CAS No. | 3779-03-1 |
|---|---|
| 분자식 | C12H10O4 |
| 평균 분자량 | 218.2 g/mol |
| 단동위원소 질량 | 218.0579088 g/mol |
| SMILES | COc1c2c(cc3ccc(=O)oc13)CCO2 |
| InChIKey | BUNGCZLFHHXKBX-UHFFFAOYSA-N |
| PubChem CID | 77409 |
| ChEMBL | CHEMBL139604 |
| EC No. | 223-238-9 |
| DTXSID | DTXSID7063188 |
| 현지명 | 9-메톡시-2,3-디히드로푸로[3,2-G]쿠마린 |
화학 및 물리적 성질
| XLogP | 1.9 |
|---|---|
| 극성 표면적 | 44.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 325 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 158-160°C |
| 저장 조건 | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| 용해도 | DMSO(약간 용해됨), 메탄올(약간 용해됨, 가열) |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| EPA | 7H-Furo[3,2-g][1]benzopyran-7-one, 2,3-dihydro-9-methoxy- (3779-03-1) |
안전 및 규제
| TSCA 등재 상태 | TSCA listed |
|---|
용도
용도
4',5'-Dihydro-8-methoxypsoralen is a furocouramin derivative with insect antifeeding activity. 4',5'-Dihydro-8-methoxypsoralen is dihydro impurity as well as a metabolite of 8-Methoxypsoralen (M260795 ), also known as Methoxsalen.