Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
헥신(1-)-3-올
헥신(1-)-3-올 · 1-헥신-3-올 · 1-헥신-3-OL · hex-1-yn-3-ol · Hexyn-3 · Hexynol · 1-HEXYN-3-OL · 1-HEXYNE-3-OL
식별자 및 물리적 특성
| CAS No. | 105-31-7 |
|---|---|
| 분자식 | C6H10O |
| 평균 분자량 | 98.14 g/mol |
| 단동위원소 질량 | 98.07316494 g/mol |
| SMILES | C#CC(O)CCC |
| InChIKey | LTFTWJYRQNTCHI-UHFFFAOYSA-N |
| PubChem CID | 7746 |
| EC No. | 203-286-7 |
| DTXSID | DTXSID4051536 |
| 현지명 | 헥신(1-)-3-올 |
화학 및 물리적 성질
| XLogP | 0.9 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 77.4 |
| 녹는점 | -80°C |
| 끓는 점 | 118 °C |
| 밀도 | 0.873 g/mL at 25 °C |
| 굴절률 | n20/D 1.431 |
| 인화점 | 117 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 투명한 액체 |
| pKa(산도 계수) | 13.28±0.20(Predicted) |
| 색상 | Colorless to Light orange to Yellow |
| BRN | 1739419 |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3 |
| InChIKey | LTFTWJYRQNTCHI-UHFFFAOYSA-N |
| SMILES | C#CC(O)CCC |
| EPA | 1-Hexyn-3-ol (105-31-7) |
화학적 성질
Light-yellow liquid; strong odor. Slightly soluble in water; miscible with most hydrocarbons, chlorinated solvents, ketones, alcohols, and glycols.
안전 및 규제
| GHS 분류 | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P262, P264, P264+P265, P270, P280, P301+P316, P302+P352, P303+P361+P353, P305+P354+P338, P316, P317, P321, P330, P361+P364, P370+P378, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 45 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: 1-Hexyn-3-ol |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | TSCA listed |
| RTECS 번호 | MR0181000 |
| 운송 번호(UN) | UN 2929 6.1/PG 1 |
| 독성 | mouse,LD50,intravenous,56mg/kg (56mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00219, |
| 관세 코드 | 29052900 |
| 위험 문구(R) | 10-25-27-41 |
| 위험 표시 | T+ |
| 안전 문구(S) | 26-28-36/37/39-45 |
| 포장분류 | III |
| 위험 등급 | 3Acute Tox. 3 OralEye Dam. 1Flam. Liq. 3 |
| 기존화학 물질 | KE-19942 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
1-Hexyn-3-ol may be used in the synthesis of racemic 3-hydroxy-2-hexanone. It may also be used in the preparation of 1,2,3-triazoles.
일반 설명
1-Hexyn-3-ol is a terminal propargylic alcohol. It undergoes microwave-accelerated coupling-isomerization reaction (MACIR) with (hetero)aryl halides to afford the corresponding enone.