Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,4-Difluorobenzonitrile
0/1/39 · 2,4-DFBN · CASNO: 3939-9-1 · 2,4-Difluorobenzonit · 2-difluorobenzotrile · 4-Difluorobenzonitrile · 2，4-difluorobenzotrile · 2,4-Difuorobenzonitrile
식별자 및 물리적 특성
| CAS No. | 3939-09-1 |
|---|---|
| 분자식 | C7H3F2N |
| 평균 분자량 | 139.1 g/mol |
| 단동위원소 질량 | 139.02335554 g/mol |
| SMILES | N#Cc1ccc(F)cc1F |
| InChIKey | LJFDXXUKKMEQKE-UHFFFAOYSA-N |
| PubChem CID | 77545 |
| EC No. | 223-523-8 |
| DTXSID | DTXSID70192582 |
화학 및 물리적 성질
| XLogP | 2 |
|---|---|
| 극성 표면적 | 23.8 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 160 |
| SpringerMaterials Properties | Diamagnetic susceptibility |
| 녹는점 | 47-49 °C (lit.) |
| 끓는 점 | 189°C |
| 밀도 | 1.246 |
| 인화점 | >230 °F |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 메탄올에 용해됨 |
| 물리적 상태 | 수정 같은 |
| 색상 | 흰색에서 거의 흰색 |
| BRN | 1940316 |
| InChI | InChI=1S/C7H3F2N/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| InChIKey | LJFDXXUKKMEQKE-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(F)C=C1F |
화학적 성질
white crystalline solid
안전 및 규제
| GHS 분류 | WarningH302 (98%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Chemical: Benzonitrile, 2,4-difluoro- |
| Hazard Classes and Categories | Acute Tox. 4 (98%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN3439 |
| 관세 코드 | 29269090 |
| 위험 문구(R) | 20/21/22-36/37/38 |
| 위험 표시 | Xn,T,Xi |
| 안전 문구(S) | 26-37/39-36/37/39-36/37 |
| 위험 등급 | 6.1Acute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Toxic |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
2,4-Difluorobenzonitrile has been used in the synthesis of:2-methylsulfonyl-4-fluorobenzylaminefluoro-3-amino-1,2-benzisoxazoles
일반 설명
2,4-Difluorobenzonitrile undergoes polycondensation with Bisphenol A and matrix-assisted laser desorption/time-of-flight mass spectra revealed a quantitative formation of cyclic oligoethers and polyethers.