Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
테트라브로모티오펜
테트라브로모티오펜 · PERBROMOTHIOPHENE · S0506 · TH-4Br · AKOS 93380 · Tetrabromthiophen · TETRABROMOTHIOPHENE · Tetrabromothiophene3
식별자 및 물리적 특성
| CAS No. | 3958-03-0 |
|---|---|
| 분자식 | C4Br4S |
| 평균 분자량 | 399.73 g/mol |
| 단동위원소 질량 | 395.6454194 g/mol |
| SMILES | Brc1sc(Br)c(Br)c1Br |
| InChIKey | AVPWUAFYDNQGNZ-UHFFFAOYSA-N |
| PubChem CID | 77565 |
| ChEMBL | CHEMBL87453 |
| EC No. | 223-554-7 |
| DTXSID | DTXSID40192695 |
| 현지명 | 테트라브로모티오펜 |
화학 및 물리적 성질
| XLogP | 5 |
|---|---|
| 극성 표면적 | 28.2 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 96.7 |
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
| 녹는점 | 116-118 °C (lit.) |
| 끓는 점 | 326 °C (lit.) |
| 밀도 | 2.836 (estimate) |
| 인화점 | 324-327°C |
| 저장 조건 | Keep in dark place,Sealed in dry,Room Temperature |
| 물리적 상태 | 결정성 분말 |
| 색상 | 크림부터 브라운까지 |
| 용해도 | 물에 불용성. 유기 용매에 용해됩니다. |
| BRN | 383664 |
| InChI | InChI=1S/C4Br4S/c5-1-2(6)4(8)9-3(1)7 |
| InChIKey | AVPWUAFYDNQGNZ-UHFFFAOYSA-N |
| SMILES | C1(Br)SC(Br)=C(Br)C=1Br |
| NIST | Thiophene, tetrabromo-(3958-03-0) |
화학적 성질
white to light yellow crystal powder
안전 및 규제
| GHS 분류 | WarningH302+H312+H332 (12.5%): Harmful if swallowed, in contact with skin or if inhaled [Warning Acute toxicity, oralacute toxicity, dermalacute toxicity, inhalation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Thiophene, tetrabromo-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Acute Tox. 4 (25%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29349990 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 24/25 |
| 위험 등급 | LIGHT SENSITIVE |
| 위험 참고 사항 | Irritant |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
Tetrabromothiophene, holds wide applications in organic electronics and photonics. It is an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.